
CAS Number80352-42-7
Synonyms(4-Bromophenyl)(oxo)acetaldehyde hydrate; (4-Brom-phenyl)-glyoxal; 1-(4-bromophenyl)-2,2-dihydroxyethanone; 1-(4-Brom-phenyl)-2,2-dihydroxy-aethanon; (4-Bromophenyl)(oxo)acetaldehyde hydrate (1:1); Benzeneacetaldehyde, 4-bromo-α-oxo-, hydrate (1:1); 4-Brom-11.12-dioxo-1-aethyl-benzol; Ethanone,1-(4-bromophenyl)-2,2-dihydroxy; 4-bromophenylglyoxal monohydrate; p-Brom-benzoyl-formaldehyd
Molecular FormulaC8H7BrO3
Molecular Weight231.043
Purity98.00%
Density1.743g/cm3
Boiling Point340ºC at 760mmHg
Melting Point132ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80352-42-7 |
| Catalog No. | 2A-9048468 |
| Chinese Name | 4-溴苯基水合乙二醛 |
| Synonyms | (4-Bromophenyl)(oxo)acetaldehyde hydrate; (4-Brom-phenyl)-glyoxal; 1-(4-bromophenyl)-2,2-dihydroxyethanone; 1-(4-Brom-phenyl)-2,2-dihydroxy-aethanon; (4-Bromophenyl)(oxo)acetaldehyde hydrate (1:1); Benzeneacetaldehyde, 4-bromo-α-oxo-, hydrate (1:1); 4-Brom-11.12-dioxo-1-aethyl-benzol; Ethanone,1-(4-bromophenyl)-2,2-dihydroxy; 4-bromophenylglyoxal monohydrate; p-Brom-benzoyl-formaldehyd |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.043 |
| Purity | 98.00 |
| Density | 1.743g/cm3 |
| Boiling Point | 340ºC at 760mmHg |
| Melting Point | 132ºC |
| HTC | 2914700090 |
| PubChem ID | 85877850 |
| SMILES | O.O=CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7BrO3/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,8,11-12H |
| InChI Key | IOONPDHKLYFDML-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclopentadienylindenylzirconium dichloride | 80155-52-8 | 2A-9048452 |
| 3,4,5-Trifluorobenzotrifluoride | 80172-04-9 | 2A-9048454 |
| 1-Iodoethyl ethyl carbonate | 80196-04-9 | 2A-9048456 |
| Cucurbit[6]uril hydrate | 80262-44-8 | 2A-9048463 |
| 2-Chloro-1-(4-isobutylphenyl)propan-1-one | 80336-66-9 | 2A-9048467 |
| 2-Formyl-3-oxo-propanoic acid ethyl ester | 80370-42-9 | 2A-9048470 |
| Methyl 5-amino-2-methansulfonyloxybenzoate | 80430-22-4 | 2A-9048475 |
| 1-Ethyl-3-methylimidazolium tetrachloroaluminate | 80432-05-9 | 2A-9048476 |
| Calcium levofolinate | 80433-71-2 | 2A-9048477 |
| (6a,11b,16a,17a)-6,9-Difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioic acid | 80473-92-3 | 2A-9048485 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA