
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80336-66-9 |
| Catalog No. | 2A-9048467 |
| Chinese Name | 2-氯-1-(4-异丁基苯基)丙酮 |
| Synonyms | 2-chloro-4'-isobutylpropiophenone; 4-isobutylphenyl 1-chloroethyl ketone; Q616 |
| Molecular Formula | C9H8O1Cl1F1 |
| Molecular Weight | 186.61 |
| Purity | 98.00 |
| Density | 1.043g/cm3 |
| Boiling Point | 319.1ºC at 760 mmHg |
| Melting Point | 52ºC |
| Storage Condition | 2-8°C, dry |
| HTC | 2914700090 |
| PubChem ID | 3211110 |
| MDL Number | MFCD13194252 |
| SMILES | CC(C)Cc1ccc(C(=O)C(C)Cl)cc1 |
| InChI | InChI=1S/C13H17ClO/c1-9(2)8-11-4-6-12(7-5-11)13(15)10(3)14/h4-7,9-10H,8H2,1-3H3 |
| InChI Key | GIHSMBINQBEFLD-UHFFFAOYSA-N |
| MSDS | msds/48467_1_80336_66_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Helicid | 80154-34-3 | 2A-9048450 |
| Cyclopentadienylindenylzirconium dichloride | 80155-52-8 | 2A-9048452 |
| 3,4,5-Trifluorobenzotrifluoride | 80172-04-9 | 2A-9048454 |
| 1-Iodoethyl ethyl carbonate | 80196-04-9 | 2A-9048456 |
| Cucurbit[6]uril hydrate | 80262-44-8 | 2A-9048463 |
| 4-Bromophenylglyoxal hydrate | 80352-42-7 | 2A-9048468 |
| 2-Formyl-3-oxo-propanoic acid ethyl ester | 80370-42-9 | 2A-9048470 |
| Methyl 5-amino-2-methansulfonyloxybenzoate | 80430-22-4 | 2A-9048475 |
| 1-Ethyl-3-methylimidazolium tetrachloroaluminate | 80432-05-9 | 2A-9048476 |
| Calcium levofolinate | 80433-71-2 | 2A-9048477 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA