
CAS Number78418-01-6
Synonyms2-Hydroxy-5-(1-oxooctyl)benzoic acid; 5-Octanoylsalicylic acid; 5-n-octanoylsalicylic acid; 2-Hydroxy-5-octanoylbenzoic acid; QVR BQ EV7
Molecular FormulaC15H20O4
Molecular Weight264.32
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point454.8±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78418-01-6 |
| Catalog No. | 2A-9048220 |
| Chinese Name | 辛酰水杨酸 |
| Synonyms | 2-Hydroxy-5-(1-oxooctyl)benzoic acid; 5-Octanoylsalicylic acid; 5-n-octanoylsalicylic acid; 2-Hydroxy-5-octanoylbenzoic acid; QVR BQ EV7 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 454.8±35.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 14799065 |
| MDL Number | MFCD11846247 |
| SMILES | CCCCCCCC(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H20O4/c1-2-3-4-5-6-7-13(16)11-8-9-14(17)12(10-11)15(18)19/h8-10,17H,2-7H2,1H3,(H,18,19) |
| InChI Key | IXIGWKNBFPKCCD-UHFFFAOYSA-N |
| MSDS | msds/48220_1_78418_01_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Safflomin A | 78281-02-4 | 2A-9048204 |
| 2-Amino-3-benzoyl-alpha-(methylthio)benzeneacetamide | 78281-61-5 | 2A-9048205 |
| 7-Ethylcamptothecin | 78287-27-1 | 2A-9048207 |
| D-1-Naphthylalanine | 78306-92-0 | 2A-9048208 |
| 2-Morpholinoethyl isocyanide | 78375-48-1 | 2A-9048216 |
| Tetrahydro-1H-pyrrolizine-7a(5H)-ethanamine dihydrochloride | 78449-85-1 | 2A-9048223 |
| 4-Amino-3,5-dichlorobenzonitrile | 78473-00-4 | 2A-9048226 |
| Praeruptorin E | 78478-28-1 | 2A-9048227 |
| Diazolidinylurea | 78491-02-8 | 2A-9048229 |
| Methyl 5-formyl-2-methoxybenzoate | 78515-16-9 | 2A-9048232 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA