
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78478-28-1 |
| Catalog No. | 2A-9048227 |
| Chinese Name | 白花前胡素E |
| Synonyms | 3'-Angeloyl-4'-isovalerylkhellactone; I07-0317; X1208; PraeruptorinE; Praeruptorin E |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 516.5±50.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Praeruptorin E is a major bioactive component of Peucedanum praeruptorum. Praeruptorin C is a calcium antagonist with a pD2′ value of 5.2. |
| PubChem ID | 24636687 |
| MDL Number | C24H28O7 |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)CC(C)C)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C24H28O7/c1-7-14(4)23(27)30-22-21(29-18(26)12-13(2)3)19-16(31-24(22,5)6)10-8-15-9-11-17(25)28-20(15)19/h7-11,13,21-22H,12H2,1-6H3/b14-7-/t21-,22-/m0/s1 |
| InChI Key | UFUVJROSOIXJGR-WLISBCLRSA-N |
| MSDS | msds/48227_1_78478_28_1.pdf |
| Transport Info | Product Name: Phytophthora leucophylla E |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-1-Naphthylalanine | 78306-92-0 | 2A-9048208 |
| 2-Morpholinoethyl isocyanide | 78375-48-1 | 2A-9048216 |
| 5-Octanoylsalicylic acid | 78418-01-6 | 2A-9048220 |
| Tetrahydro-1H-pyrrolizine-7a(5H)-ethanamine dihydrochloride | 78449-85-1 | 2A-9048223 |
| 4-Amino-3,5-dichlorobenzonitrile | 78473-00-4 | 2A-9048226 |
| Diazolidinylurea | 78491-02-8 | 2A-9048229 |
| Methyl 5-formyl-2-methoxybenzoate | 78515-16-9 | 2A-9048232 |
| 6-[[(4-Methylphenyl)sulphonyl]amino]hexanoic acid | 78521-39-8 | 2A-9048233 |
| 2-Amino-1,3-dimethoxypropane | 78531-29-0 | 2A-9048234 |
| O-tert-Butyl-D-serine methyl ester hydrochloride | 78537-14-1 | 2A-9048235 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA