
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5731-13-5 |
| Catalog No. | 2A-9004805 |
| Chinese Name | 对乙基联苯甲酸 |
| Synonyms | 4-(4-ethylphenyl)benzoic acid; EINECS 227-236-9; MFCD00010210 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| Purity | 99.5 |
| Density | 1.13g/cm3 |
| Boiling Point | 389.8ºC at 760 mmHg |
| Appearance | White to cream solid |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2916399090 |
| MDL Number | MFCD00010210 |
| SMILES | CCc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H14O2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10H,2H2,1H3,(H,16,17)/p-1 |
| InChI Key | SCEBDBNGUCNRCE-UHFFFAOYSA-N |
| MSDS | msds/4805_1_5731_13_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3-Nitrophenyl)thiazol-2-ylamine | 57493-24-0 | 2A-9004792 |
| 4'-(4-Bromobenzyloxy)acetophenone | 694443-80-6 | 2A-9004797 |
| 4-(4'-Bromobiphenyl-4-yl)thiazol-2-ylamine | 676348-26-8 | 2A-9004798 |
| 4-(4-Chloro-3-methylphenoxy)-3-nitrobenzotrifluoride | 1799-97-9 | 2A-9004799 |
| 4-(4-Chloro-L-cyanobenzyl)-(2H)-phthalazinone | 2A-104800 | 2A-9004800 |
| 4-(4-Ethylphenyl)phenol | 21345-28-8 | 2A-9004806 |
| 4-(4-Hydroxyphenyl)-2-butanone | 5471-51-2 | 2A-9004810 |
| 4-(4-Methoxy-2,3,6-trimethylphenyl)-but-3-en-2-one | 54757-47-0 | 2A-9004812 |
| 4-(4-Methoxyphenyl)-2-butanone | 104-20-1 | 2A-9004813 |
| 4-(4-Methoxyphenyl)butyric acid | 4521-28-2 | 2A-9004814 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA