
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57493-24-0 |
| Catalog No. | 2A-9004792 |
| Chinese Name | 4-(3-硝基苯基)噻唑-2-胺 |
| Synonyms | 4-(3-nitrophenyl)-1,3-thiazol-2-amine; MFCD00022455 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.239 |
| Purity | 98 |
| Density | 1.459g/cm3 |
| Boiling Point | 447.2ºC at 760mmHg |
| Melting Point | 189 °C |
| Appearance | Solid;Light orange to Yellow to Green powder to crystal |
| Storage Condition | Store in inert gas; avoid air |
| HTC | 2934100090 |
| MDL Number | MFCD00022455 |
| SMILES | Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11) |
| InChI Key | CHBDOPARQRNCDM-UHFFFAOYSA-N |
| MSDS | msds/4792_1_57493_24_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-Piperidinoethoxy)benzoic acid hydrochloride | 84449-80-9 | 2A-9004780 |
| 4-(3,3-Dimethylureido)benzoic acid | 91880-51-2 | 2A-9004782 |
| 4-(3,4-Dichlorobenzyloxy)cinnamic acid | 175136-15-9 | 2A-9004785 |
| 4-(3,4-Dichlorophenyl)-3,4-dihydro-1(2H)-naphthalene-1-one | 79560-19-3 | 2A-9004786 |
| 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine | 676348-24-6 | 2A-9004789 |
| 4'-(4-Bromobenzyloxy)acetophenone | 694443-80-6 | 2A-9004797 |
| 4-(4'-Bromobiphenyl-4-yl)thiazol-2-ylamine | 676348-26-8 | 2A-9004798 |
| 4-(4-Chloro-3-methylphenoxy)-3-nitrobenzotrifluoride | 1799-97-9 | 2A-9004799 |
| 4-(4-Chloro-L-cyanobenzyl)-(2H)-phthalazinone | 2A-104800 | 2A-9004800 |
| 4-(4-Ethylphenyl)benzoic acid | 5731-13-5 | 2A-9004805 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA