
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75102-74-8 |
| Catalog No. | 2A-9047830 |
| Chinese Name | 7-氯-D-色氨酸 |
| Synonyms | Exact Mass 238.050903; PSA 79.11000; LogP 2.14; Index of Refraction 1.702; InChIKey DMQFGLHRDFQKNR-SECBINFHSA-N |
| Molecular Formula | C11H11O2N2Cl1 |
| Molecular Weight | 238.67 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 476.9±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 26718281 |
| MDL Number | MFCD09264323 |
| SMILES | NC(Cc1c[nH]c2c(Cl)cccc12)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-3,5,9,14H,4,13H2,(H,15,16)/t9-/m1/s1 |
| InChI Key | DMQFGLHRDFQKNR-SECBINFHSA-N |
| MSDS | msds/47830_1_75102_74_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methoxybutyl chloroformate | 75032-87-0 | 2A-9047823 |
| 4-(2-Chloroethylsulfonyl)butanoic acid | 75055-25-3 | 2A-9047824 |
| 4-Hydroxy-2,6-dimethylbenzoic acid | 75056-97-2 | 2A-9047825 |
| N-Tosyl-L-alanine 3-indoxyl ester | 75062-54-3 | 2A-9047826 |
| Isopropyl-9H-thioxanthen-9-one | 75081-21-9 | 2A-9047827 |
| 3-Isobutylglutaric acid | 75143-89-4 | 2A-9047832 |
| Acridine Orange 10-nonyl bromide | 75168-11-5 | 2A-9047835 |
| L-4-Methoxymandelic acid | 75172-66-6 | 2A-9047837 |
| Zofenoprilat | 75176-37-3 | 2A-9047838 |
| 4-Aminophenylglycine | 75176-85-1 | 2A-9047839 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA