
CAS Number75081-21-9
Synonyms9H-thioxanthen-9-one,1-(1-methylethyl); Runtecure 1105; ISOPROPYL-9H-THIOXANTHEN-9-ONE; Isopropylthioxanthone; DarocurITX; 9H-Thioxanthen-9-one,(1-methylethyl); 1-(propan-2-yl)-9H-thioxanthen-9-one; MFCD00192247; H686; Genocure ITX; ITX-S
Molecular FormulaC16H14OS
Molecular Weight254.34700
Purity98.00%
Density1.199 g/cm3
Boiling Point400.135ºC at 760 mmHg
Appearanceyellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75081-21-9 |
| Catalog No. | 2A-9047827 |
| Chinese Name | 异丙基-9H-噻吨-9-酮 |
| Synonyms | 9H-thioxanthen-9-one,1-(1-methylethyl); Runtecure 1105; ISOPROPYL-9H-THIOXANTHEN-9-ONE; Isopropylthioxanthone; DarocurITX; 9H-Thioxanthen-9-one,(1-methylethyl); 1-(propan-2-yl)-9H-thioxanthen-9-one; MFCD00192247; H686; Genocure ITX; ITX-S |
| Molecular Formula | C16H14OS |
| Molecular Weight | 254.34700 |
| Purity | 98.00 |
| Density | 1.199 g/cm3 |
| Boiling Point | 400.135ºC at 760 mmHg |
| Appearance | yellow powder |
| Storage Condition | room temperature |
| PubChem ID | 14749960 |
| SMILES | CC(C)c1cccc2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C16H14OS/c1-10(2)11-7-5-9-14-15(11)16(17)12-6-3-4-8-13(12)18-14/h3-10H,1-2H3 |
| InChI Key | YIKSHDNOAYSSPX-UHFFFAOYSA-N |
| Transport Info | Product name: Isopropyl-9H-sulfanogen-9-one, a mixture of 2- and 4-isomers |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[2-(2-Phthalimidoethoxy)ethoxy]acetic acid | 75001-09-1 | 2A-9047820 |
| 3-Methoxybutyl chloroformate | 75032-87-0 | 2A-9047823 |
| 4-(2-Chloroethylsulfonyl)butanoic acid | 75055-25-3 | 2A-9047824 |
| 4-Hydroxy-2,6-dimethylbenzoic acid | 75056-97-2 | 2A-9047825 |
| N-Tosyl-L-alanine 3-indoxyl ester | 75062-54-3 | 2A-9047826 |
| 7-Chloro-D-tryptophan | 75102-74-8 | 2A-9047830 |
| 3-Isobutylglutaric acid | 75143-89-4 | 2A-9047832 |
| Acridine Orange 10-nonyl bromide | 75168-11-5 | 2A-9047835 |
| L-4-Methoxymandelic acid | 75172-66-6 | 2A-9047837 |
| Zofenoprilat | 75176-37-3 | 2A-9047838 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA