
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 69033-81-4 |
| Catalog No. | 2A-9046957 |
| Chinese Name | 4-丙氧基肉桂酸 |
| Synonyms | 3-(4-propoxyphenyl)acrylic acid |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| Purity | 98.00 |
| Density | 1.132g/cm3 |
| Boiling Point | 364.8ºC at 760 mmHg |
| Melting Point | 166.0 to 172.0 °C |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 11852042 |
| MDL Number | MFCD00995149 |
| SMILES | CCCOc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C12H14O3/c1-2-9-15-11-6-3-10(4-7-11)5-8-12(13)14/h3-8H,2,9H2,1H3,(H,13,14)/b8-5+ |
| InChI Key | WTYNDSOJMSGRQV-VMPITWQZSA-N |
| MSDS | msds/46957_1_69033_81_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Beef extract | 68990-09-0 | 2A-9046950 |
| Fenugreek Oils | 68990-15-8 | 2A-9046951 |
| Dandelion extract | 68990-74-9 | 2A-9046952 |
| Toltrazuril sulfone | 69004-04-2 | 2A-9046954 |
| Silica fumes | 69012-64-2 | 2A-9046956 |
| Nedocromil sodium | 69049-74-7 | 2A-9046965 |
| (6R)-5,6,7,8-Tetrahydro-L-biopterin dihydrochloride | 69056-38-8 | 2A-9046966 |
| 2-methyl-1-nitropropane | 625-74-1 | 2A-9046968 |
| Fiacitabine | 69123-90-6 | 2A-9046971 |
| 4-Methoxycyclohex-3-en-1-ol | 69125-55-9 | 2A-9046974 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA