
CAS Number66137-74-4
Synonyms5-iodooctafluoro-3-oxa-pentanesulfonyl fluoride; MFCD00798139; 5-iodooctafluoro-3-oxapentane-1-sulfonyl fluoride; EINECS 266-172-6; 5-Iodooctafluoro-3-oxapentanesulphonyl fluoride; tetrafluoro-2-tetrafluoro-2-iodoethoxyethanesulphonyl fluoride; 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
Molecular FormulaICF2CF2OCF2CF2SO2F
Molecular Weight426.00
Purity97%
Density2.2±0.1 g/cm3
Boiling Point127 °C (lit.)
Appearancepink to orange to purple liquid
EINECS266-172-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 66137-74-4 |
| Catalog No. | 2A-9046386 |
| Chinese Name | 2-(2-碘-四氟乙氧基)四氟乙基硫酰氟 |
| Synonyms | 5-iodooctafluoro-3-oxa-pentanesulfonyl fluoride; MFCD00798139; 5-iodooctafluoro-3-oxapentane-1-sulfonyl fluoride; EINECS 266-172-6; 5-Iodooctafluoro-3-oxapentanesulphonyl fluoride; tetrafluoro-2-tetrafluoro-2-iodoethoxyethanesulphonyl fluoride; 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride |
| Molecular Formula | ICF2CF2OCF2CF2SO2F |
| Molecular Weight | 426.00 |
| Purity | 97 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 127 °C (lit.) |
| Appearance | pink to orange to purple liquid |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| Packaging | II |
| EINECS | 266-172-6 |
| PubChem ID | 24870937 |
| MDL Number | MFCD00798139 |
| SMILES | FC(F)(I)C(F)(F)OC(F)(F)C(F)(F)S(F)(=O)=O |
| InChI | 1S/C4F9IO3S/c5-1(6,14)2(7,8)17-3(9,10)4(11,12)18(13,15)16 |
| InChI Key | XSLYISNQTJHKMP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8.0 |
| MSDS | msds/46386_1_66137_74_4.pdf |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Succinimidyl 2,2,2-trichloroethyl carbonate | 66065-85-8 | 2A-9046374 |
| 2-Methoxy-4-pyridinol | 66080-45-3 | 2A-9046378 |
| Pergolide mesylate salt | 66104-23-2 | 2A-9046381 |
| Pomegranate, ext. | 84961-57-9 | 2A-9046382 |
| 3-Bromo-1,10-phenanthroline | 66127-01-3 | 2A-9046385 |
| Temocillin | 66148-78-5 | 2A-9046388 |
| Sodium L-ascorbyl-2-phosphate | 66170-10-3 | 2A-9046390 |
| Methyl 6-hydroxynicotinate | 66171-50-4 | 2A-9046391 |
| Methyl 3-(2-bromophenyl)propionate | 66191-86-4 | 2A-9046395 |
| 2-Amino-6-ethylbenzoic acid | 66232-56-2 | 2A-9046401 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA