
CAS Number64953-12-4
Synonymslatamoxefsodium; Antibiotic 6059-S; Shionogi 6059S; EINECS 265-288-4; UNII:5APW73W3QZ; MFCD03427565; Festamoxin; S 6059; Disodium Latamoxef; antibiotic6059-s; moxam; MOXALACTAM (HYDROLYZED); Shiomarin; 6059S; moxalactam disodium; Moxalactam (sodium salt)
Molecular FormulaC20H18N6Na2O9S
Molecular Weight564.44
Purity98.00%
AppearanceLight yellow powder
EINECS265-288-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64953-12-4 |
| Catalog No. | 2A-9046173 |
| Chinese Name | 拉氧头孢 钠盐 |
| Synonyms | latamoxefsodium; Antibiotic 6059-S; Shionogi 6059S; EINECS 265-288-4; UNII:5APW73W3QZ; MFCD03427565; Festamoxin; S 6059; Disodium Latamoxef; antibiotic6059-s; moxam; MOXALACTAM (HYDROLYZED); Shiomarin; 6059S; moxalactam disodium; Moxalactam (sodium salt) |
| Molecular Formula | C20H18N6Na2O9S |
| Molecular Weight | 564.44 |
| Purity | 98.00 |
| Appearance | Light yellow powder |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Application | Moxalactam sodium salt is an antibiotic compound that is more effective than cephalosporins against Escherichia coli and Pseudomonas aeruginosa. |
| EINECS | 265-288-4 |
| PubChem ID | 24897229 |
| MDL Number | MFCD03427565 |
| SMILES | [Na+].[Na+].COC2(NC(=O)C(C([O-])=O)c1ccc(O)cc1)C3OCC(CSc4nnnn4C)=C(N3C2=O)C([O-])=O |
| InChI | 1S/C20H20N6O9S.2Na/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9;;/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32);;/q;2*+1/p-2 |
| InChI Key | GRIXGZQULWMCLU-UHFFFAOYSA-L |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/46173_1_64953_12_4.pdf |
| Transport Info | Product name: Moxalactam sodium salt |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Bromo-1,8-naphthyridin-2-amine | 64874-38-0 | 2A-9046159 |
| Urapidil hydrochloride | 64887-14-5 | 2A-9046160 |
| Ethyl 2-oxo-4-phenylbutyrate | 64920-29-2 | 2A-9046163 |
| Halofuginone hydrobromide | 64924-67-0 | 2A-9046164 |
| Latamoxef | 64952-97-2 | 2A-9046172 |
| D-Aspartic acid 4-tert-butyl ester | 64960-75-4 | 2A-9046174 |
| 2,5-Dichlorobenzoyl cyanide | 64985-85-9 | 2A-9046177 |
| (3alpha,5beta,7alpha,12alpha)-7,12-Bis(formyloxy)-3-hydroxycholan-24-oic acid | 64986-86-3 | 2A-9046178 |
| Ethyl 2-formamidothiazol-4-acetate | 64987-05-9 | 2A-9046179 |
| (2-Formamido-1,3-thiazol-4-yl)glyoxylic acid | 64987-06-0 | 2A-9046180 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA