CAS Number64920-29-2
SynonymsEthyl 2-oxo-4-phenylbutanoate; 2-oxo-4-phenyl-butyric acid ethyl ester; BENZYLPYRUVIC ACID ETHYL ESTER; EINECS 265-276-9; 2-oxo-4-phenylhexanoate; MFCD00037533; Ethy 2-oxo-4-phenylbutyrate; Ethyl-2-oxo-4-phenylbutanoat; ethyl 2-keto-4-phenylbutyrate; 4-phenyl-2-oxobutyric acid ethyl ester; Benzenebutanoic acid, α-oxo-, ethyl ester; Ethyl 4-phenyl-2-oxobutanoate; ethyl 2-oxo-4-phenyl-butyrate; KETO ESTER; ETHYL-2 OXO-4 PHENYL BUTANOATE; ETHYL BENZYLPYRUVATE; ETHYL-2-OXO-4-PHENYLBUTRATE; 2-oxo-4-phenylbutanoic acid ethyl ester
Molecular FormulaC6H5CH2CH2CH(OH)CO2C2H5
Molecular Weight208.25
Purity98%
Density1.1±0.1 g/cm3
Boiling Point212 °C (lit.)
AppearanceLight yellow or yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64920-29-2 |
| Catalog No. | 2A-9046163 |
| Chinese Name | 2-氧代-基丁酸乙酯 |
| Synonyms | Ethyl 2-oxo-4-phenylbutanoate; 2-oxo-4-phenyl-butyric acid ethyl ester; BENZYLPYRUVIC ACID ETHYL ESTER; EINECS 265-276-9; 2-oxo-4-phenylhexanoate; MFCD00037533; Ethy 2-oxo-4-phenylbutyrate; Ethyl-2-oxo-4-phenylbutanoat; ethyl 2-keto-4-phenylbutyrate; 4-phenyl-2-oxobutyric acid ethyl ester; Benzenebutanoic acid, α-oxo-, ethyl ester; Ethyl 4-phenyl-2-oxobutanoate; ethyl 2-oxo-4-phenyl-butyrate; KETO ESTER; ETHYL-2 OXO-4 PHENYL BUTANOATE; ETHYL BENZYLPYRUVATE; ETHYL-2-OXO-4-PHENYLBUTRATE; 2-oxo-4-phenylbutanoic acid ethyl ester |
| Molecular Formula | C6H5CH2CH2CH(OH)CO2C2H5 |
| Molecular Weight | 208.25 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 212 °C (lit.) |
| Appearance | Light yellow or yellow liquid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918300090 |
| PubChem ID | 24869747 |
| MDL Number | MFCD00077794 |
| SMILES | CCOC(=O)[C@H](O)CCc1ccccc1 |
| InChI | 1S/C12H16O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7,11,13H,2,8-9H2,1H3/t11-/m1/s1 |
| InChI Key | ZJYKSSGYDPNKQS-LLVKDONJSA-N |
| Beilstein/REAXYS | 3590943 |
| NACRES Code | NA.22 |
| UNSPSC | 12352108 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Light aromatic solvent naphtha | 64742-95-6 | 2A-9046146 |
| 4-((2-Furylmethyl)thio)-4-methylpentan-2-one | 64835-96-7 | 2A-9046153 |
| Butoconazole nitrate | 64872-77-1 | 2A-9046158 |
| 6-Bromo-1,8-naphthyridin-2-amine | 64874-38-0 | 2A-9046159 |
| Urapidil hydrochloride | 64887-14-5 | 2A-9046160 |
| Halofuginone hydrobromide | 64924-67-0 | 2A-9046164 |
| Latamoxef | 64952-97-2 | 2A-9046172 |
| Latamoxef sodium | 64953-12-4 | 2A-9046173 |
| D-Aspartic acid 4-tert-butyl ester | 64960-75-4 | 2A-9046174 |
| 2,5-Dichlorobenzoyl cyanide | 64985-85-9 | 2A-9046177 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS