![[(6-Oxido-6H-dibenz[c,e][1,2]oxaphosphorin-6-yl)methyl]butanedioic acid structure, CAS 63562-33-4](/structures/60000/45926_1_63562_33_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63562-33-4 |
| Catalog No. | 2A-9045926 |
| Chinese Name | 阻燃剂 DDP |
| Synonyms | MFCD13152156 |
| Molecular Formula | C17H15O6P1 |
| Molecular Weight | 346.27100 |
| Purity | 98.00 |
| Density | 1.48 g/cm3 |
| Boiling Point | 578.3ºC at 760 mmHg |
| Melting Point | 191--192ºC |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 11973021 |
| MDL Number | MFCD13152156 |
| SMILES | [P]1(=O)(Oc2c(cccc2)c3c1cccc3)CC(CC(=O)O)C(=O)O |
| InChI | 1S/C17H15O6P/c18-16(19)9-11(17(20)21)10-24(22)15-8-4-2-6-13(15)12-5-1-3-7-14(12)23-24/h1-8,11H,9-10H2,(H,18,19)(H,20,21) |
| InChI Key | XZAXQWXHBDKYJI-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/45926_1_63562_33_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-methoxy-5-methylsulfonylbenzoate | 63484-12-8 | 2A-9045910 |
| 2-Pentylamine | 63493-28-7 | 2A-9045911 |
| Flutropium bromide | 63516-07-4 | 2A-9045916 |
| Cefazedone sodium salt | 63521-15-3 | 2A-9045918 |
| 4-Mercaptohydrocinnamic acid | 63545-55-1 | 2A-9045921 |
| Bis(2-hydroxyethyl)(6H-dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)succinate P-oxide | 63562-34-5 | 2A-9045927 |
| 9,10-Dihydro-9-oxa-10-phosphaphenanthrene-10-propanoic acid methyl ester 10-oxide | 63562-42-5 | 2A-9045929 |
| 4-Diazo-3,4-dihydro-7-nitro-3-oxo-1-naphthalenesulfonic acid | 63589-25-3 | 2A-9045932 |
| 2-Bromo-5-methoxyphenol | 63604-94-4 | 2A-9045935 |
| Lodoxamide tromethamine | 63610-09-3 | 2A-9045937 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA