
CAS Number63545-55-1
Synonyms[3-(4-mercaptoethyl)]propanoic acid; benzenepropanoic acid,4-mercapto; p-Mercaptohydrocinnamic Acid; 4-(2-carboxyethyl)phenylthiol; 4-mercaptodihydrocinnamic acid; 4-Mercaptohydrocinnamic Acid
Molecular FormulaC9H10O2S
Molecular Weight182.23900
Purity98.00%
Density1.248g/cm3
Boiling Point345.1ºC at 760 mmHg
Melting Point118ºC
Appearanceyellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63545-55-1 |
| Catalog No. | 2A-9045921 |
| Chinese Name | 4-巯基氢化肉桂酸 |
| Synonyms | [3-(4-mercaptoethyl)]propanoic acid; benzenepropanoic acid,4-mercapto; p-Mercaptohydrocinnamic Acid; 4-(2-carboxyethyl)phenylthiol; 4-mercaptodihydrocinnamic acid; 4-Mercaptohydrocinnamic Acid |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.23900 |
| Purity | 98.00 |
| Density | 1.248g/cm3 |
| Boiling Point | 345.1ºC at 760 mmHg |
| Melting Point | 118ºC |
| Appearance | yellow powder |
| Storage Condition | Store in a sealed container filled with inert gas |
| HTC | 2930909090 |
| PubChem ID | 6760315 |
| SMILES | O=C(O)CCc1ccc(S)cc1 |
| InChI | InChI=1S/C9H10O2S/c10-9(11)6-3-7-1-4-8(12)5-2-7/h1-2,4-5,12H,3,6H2,(H,10,11) |
| InChI Key | YQWPHBFLHAJVCG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Heptyn-1-ol | 63478-76-2 | 2A-9045909 |
| Methyl 2-methoxy-5-methylsulfonylbenzoate | 63484-12-8 | 2A-9045910 |
| 2-Pentylamine | 63493-28-7 | 2A-9045911 |
| Flutropium bromide | 63516-07-4 | 2A-9045916 |
| Cefazedone sodium salt | 63521-15-3 | 2A-9045918 |
| [(6-Oxido-6H-dibenz[c,e][1,2]oxaphosphorin-6-yl)methyl]butanedioic acid | 63562-33-4 | 2A-9045926 |
| Bis(2-hydroxyethyl)(6H-dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)succinate P-oxide | 63562-34-5 | 2A-9045927 |
| 9,10-Dihydro-9-oxa-10-phosphaphenanthrene-10-propanoic acid methyl ester 10-oxide | 63562-42-5 | 2A-9045929 |
| 4-Diazo-3,4-dihydro-7-nitro-3-oxo-1-naphthalenesulfonic acid | 63589-25-3 | 2A-9045932 |
| 2-Bromo-5-methoxyphenol | 63604-94-4 | 2A-9045935 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA