
CAS Number63516-07-4
Synonyms[8-(2-Fluoroethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide; Ba 598Br; Flutropiumbromid; Flubron; Ba 598; Flutropium
Molecular FormulaC24H29BrFNO3
Molecular Weight478.39400
Purity98.00%
Melting Point192-193° (dec); mp 198-199° (dec)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63516-07-4 |
| Catalog No. | 2A-9045916 |
| Chinese Name | 氟托溴铵 |
| Synonyms | [8-(2-Fluoroethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide; Ba 598Br; Flutropiumbromid; Flubron; Ba 598; Flutropium |
| Molecular Formula | C24H29BrFNO3 |
| Molecular Weight | 478.39400 |
| Purity | 98.00 |
| Melting Point | 192-193° (dec); mp 198-199° (dec) |
| Storage Condition | 2-8°C |
| Application | Fluotropium bromide (Ba 598Br) is the organic bromide salt of fluotropium bromide. Fluotropium bromide has anticholinergic effects. Fluotropium bromide effectively inhibits spasms and can be used in t |
| PubChem ID | 24639907 |
| SMILES | C[N+]1(CCF)C2CCC1CC(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C24H29FNO3.BrH/c1-26(15-14-25)20-12-13-21(26)17-22(16-20)29-23(27)24(28,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,20-22,28H,12-17H2,1H3;1H/q+1;/p-1/t20-,21-,22?,26?;/m1./s1 |
| InChI Key | FNUZASGZEHGWQM-QCERWEEGSA-M |
| Transport Info | Product name: Fluotropium bromide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Chlorinated paraffin | 63449-39-8 | 2A-9045903 |
| Benzalkonium chloride | 63449-41-2 | 2A-9045904 |
| 6-Heptyn-1-ol | 63478-76-2 | 2A-9045909 |
| Methyl 2-methoxy-5-methylsulfonylbenzoate | 63484-12-8 | 2A-9045910 |
| 2-Pentylamine | 63493-28-7 | 2A-9045911 |
| Cefazedone sodium salt | 63521-15-3 | 2A-9045918 |
| 4-Mercaptohydrocinnamic acid | 63545-55-1 | 2A-9045921 |
| [(6-Oxido-6H-dibenz[c,e][1,2]oxaphosphorin-6-yl)methyl]butanedioic acid | 63562-33-4 | 2A-9045926 |
| Bis(2-hydroxyethyl)(6H-dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)succinate P-oxide | 63562-34-5 | 2A-9045927 |
| 9,10-Dihydro-9-oxa-10-phosphaphenanthrene-10-propanoic acid methyl ester 10-oxide | 63562-42-5 | 2A-9045929 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA