
CAS Number56932-44-6
SynonymsMFCD00156329; 2-[(2-Amino-4-nitrophenyl)amino]ethanol; EINECS 260-450-0; 2-(2-amino-4-nitroanilino)ethanol
Molecular FormulaC8H11N3O3
Molecular Weight197.191
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point462.4±40.0 °C at 760 mmHg
Melting Point133-135 °C(lit.)
AppearanceYellow brown crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56932-44-6 |
| Catalog No. | 2A-9044724 |
| Chinese Name | 2-(2-氨基-4-硝基苯胺基)乙醇 |
| Synonyms | MFCD00156329; 2-[(2-Amino-4-nitrophenyl)amino]ethanol; EINECS 260-450-0; 2-(2-amino-4-nitroanilino)ethanol |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.191 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 462.4±40.0 °C at 760 mmHg |
| Melting Point | 133-135 °C(lit.) |
| Appearance | Yellow brown crystal powder |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2922199090 |
| PubChem ID | 4976190 |
| SMILES | Nc1cc([N+](=O)[O-])ccc1NCCO |
| InChI | InChI=1S/C8H11N3O3/c9-7-5-6(11(13)14)1-2-8(7)10-3-4-12/h1-2,5,10,12H,3-4,9H2 |
| InChI Key | OWMQBFHMJVSJSA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dibromobenzyl bromide | 56908-88-4 | 2A-9044718 |
| 1-(3-Hydroxyphenyl)-2-[methyl(phenylmethyl)amino]ethan-1-one | 56917-44-3 | 2A-9044720 |
| 5-Bromo-2-methylbenzene-1-sulfonic acid | 56919-17-6 | 2A-9044721 |
| (2E)-3-(3,5-Dibromo-4-hydroxyphenyl)-2-propenoic acid | 56926-78-4 | 2A-9044722 |
| Crotylamine | 56930-04-2 | 2A-9044723 |
| 3-Amino-2-chlorophenol | 56962-01-7 | 2A-9044731 |
| 3-Bromo-5-chlorophenol | 56962-04-0 | 2A-9044732 |
| 5-Chloro-2-(2-chlorophenoxy)aniline | 56966-48-4 | 2A-9044734 |
| 1-(4-Bromophenoxy)-2-nitrobenzene | 56966-62-2 | 2A-9044735 |
| 3-Methoxy-4-phenylaniline | 56970-24-2 | 2A-9044736 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA