
CAS Number56908-88-4
SynonymsMFCD00052415; 1,3-Dibromo-5-(bromomethyl)benzene
Molecular FormulaC7H5Br3
Molecular Weight328.83
Purity98.00%
Density2.2±0.1 g/cm3
Boiling Point316.5±27.0 °C at 760 mmHg
Melting Point93-97 °C
AppearanceWhite to beige-brown powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56908-88-4 |
| Catalog No. | 2A-9044718 |
| Chinese Name | 3,5-二溴溴苄 |
| Synonyms | MFCD00052415; 1,3-Dibromo-5-(bromomethyl)benzene |
| Molecular Formula | C7H5Br3 |
| Molecular Weight | 328.83 |
| Purity | 98.00 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 316.5±27.0 °C at 760 mmHg |
| Melting Point | 93-97 °C |
| Appearance | White to beige-brown powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2903999090 |
| PubChem ID | 3213527 |
| SMILES | BrCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H5Br3/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| InChI Key | PWTFRUXTAFBWBW-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Amiprilose | 56824-20-5 | 2A-9044707 |
| 6,7-Dihydro-5H-quinolin-8-one | 56826-69-8 | 2A-9044710 |
| 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-alpha-D-glucopyranose | 56883-33-1 | 2A-9044715 |
| Propylhydrazine oxalate salt | 56884-75-4 | 2A-9044716 |
| Ethyl 3-cyano-2-mercapto-6-methylisonicotinate | 56891-69-1 | 2A-9044717 |
| 1-(3-Hydroxyphenyl)-2-[methyl(phenylmethyl)amino]ethan-1-one | 56917-44-3 | 2A-9044720 |
| 5-Bromo-2-methylbenzene-1-sulfonic acid | 56919-17-6 | 2A-9044721 |
| (2E)-3-(3,5-Dibromo-4-hydroxyphenyl)-2-propenoic acid | 56926-78-4 | 2A-9044722 |
| Crotylamine | 56930-04-2 | 2A-9044723 |
| 2-Amino-4-nitro-N-(2-hydroxyethyl)aniline | 56932-44-6 | 2A-9044724 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA