
CAS Number56962-01-7
Synonyms3-Amino-2-chlor-phenol; 3-amino-2-chloro-phenol; 2-Chloro-3-hydroxyaniline; 3-Amino-2-chlorophenol; 2-Chloro-3-aminophenol; Phenol,3-amino-2-chloro
Molecular FormulaC6H6ClNO
Molecular Weight143.57
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point253.0±20.0 °C at 760 mmHg
Melting Point110-111ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56962-01-7 |
| Catalog No. | 2A-9044731 |
| Chinese Name | 3-氨基-2-氯苯酚 |
| Synonyms | 3-Amino-2-chlor-phenol; 3-amino-2-chloro-phenol; 2-Chloro-3-hydroxyaniline; 3-Amino-2-chlorophenol; 2-Chloro-3-aminophenol; Phenol,3-amino-2-chloro |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 253.0±20.0 °C at 760 mmHg |
| Melting Point | 110-111ºC |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 8689696 |
| SMILES | Nc1cccc(O)c1Cl |
| InChI | InChI=1S/C6H6ClNO/c7-6-4(8)2-1-3-5(6)9/h1-3,9H,8H2 |
| InChI Key | CFWIOOCJVYJEID-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3-Hydroxyphenyl)-2-[methyl(phenylmethyl)amino]ethan-1-one | 56917-44-3 | 2A-9044720 |
| 5-Bromo-2-methylbenzene-1-sulfonic acid | 56919-17-6 | 2A-9044721 |
| (2E)-3-(3,5-Dibromo-4-hydroxyphenyl)-2-propenoic acid | 56926-78-4 | 2A-9044722 |
| Crotylamine | 56930-04-2 | 2A-9044723 |
| 2-Amino-4-nitro-N-(2-hydroxyethyl)aniline | 56932-44-6 | 2A-9044724 |
| 3-Bromo-5-chlorophenol | 56962-04-0 | 2A-9044732 |
| 5-Chloro-2-(2-chlorophenoxy)aniline | 56966-48-4 | 2A-9044734 |
| 1-(4-Bromophenoxy)-2-nitrobenzene | 56966-62-2 | 2A-9044735 |
| 3-Methoxy-4-phenylaniline | 56970-24-2 | 2A-9044736 |
| 3-Phenyl-4-anisidine | 56970-26-4 | 2A-9044737 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA