
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54173-39-6 |
| Catalog No. | 2A-9044144 |
| Chinese Name | 2'-硝基-3',4',5'-三甲氧基苯乙酮 |
| Synonyms | Exact Mass 255.07400; PSA 90.58000; LogP 2.34640; Index of Refraction 1.526; InChIKey ZHVMCSUVRFDCIY-UHFFFAOYSA-N |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.22400 |
| Purity | 98.00 |
| Density | 1.246g/cm3 |
| Boiling Point | 423.6ºC at 760mmHg |
| HTC | 2914700090 |
| PubChem ID | 37178923 |
| SMILES | COc1cc(C(C)=O)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C11H13NO6/c1-6(13)7-5-8(16-2)10(17-3)11(18-4)9(7)12(14)15/h5H,1-4H3 |
| InChI Key | ZHVMCSUVRFDCIY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2'-Naphthalenethio)-1,2-phenylenediamine | 54092-93-2 | 2A-9044131 |
| 3-Oxo-3-(2-pyridinyl)propanenitrile | 54123-21-6 | 2A-9044133 |
| trans-1-Methoxy-3-(trimethylsiloxy)-1,3-butadiene | 54125-02-9 | 2A-9044134 |
| 1-Isocyanato-3,5-dimethoxybenzene | 54132-76-2 | 2A-9044138 |
| 1-Bromo-2-(2-methoxyethoxy)ethane | 54149-17-6 | 2A-9044142 |
| Sucralfate | 54182-58-0 | 2A-9044145 |
| Sodium polymethacrylate | 54193-36-1 | 2A-9044147 |
| 6-Methoxy-3,4-dihydro-1H-quinolin-2-one | 54197-64-7 | 2A-9044148 |
| 2-Hydroxyethanimidamide monohydrochloride | 54198-71-9 | 2A-9044150 |
| (1S)-(-)-Camphanic acid amide | 54200-37-2 | 2A-9044153 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA