
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52692-09-8 |
| Catalog No. | 2A-9043830 |
| Chinese Name | 4-碘-2-硝基苯甲醚 |
| Synonyms | 4-iodo-1-methoxy-2-nitrobenzene; MFCD08060933; 4-Iodo-2-nitroanisole |
| Molecular Formula | C7H6INO3 |
| Molecular Weight | 279.035 |
| Purity | 98.00 |
| Density | 1.893g/cm3 |
| Boiling Point | 330.8ºC at 760mmHg |
| Melting Point | 96-98ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 57418179 |
| MDL Number | MFCD00024328 |
| SMILES | COc1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6INO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| InChI Key | WULXGCDMVLQZBT-UHFFFAOYSA-N |
| MSDS | msds/43830_1_52692_09_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Mesitylacetyl chloride | 52629-46-6 | 2A-9043819 |
| Kirenol | 52659-56-0 | 2A-9043822 |
| 2-Ethynylaniline | 52670-38-9 | 2A-9043824 |
| 4-Amino-3-chlorophenol hydrochloride | 52671-64-4 | 2A-9043825 |
| Octan-2-yl 2-cyanoacetate | 52688-08-1 | 2A-9043829 |
| Disperse Violet 93 | 52697-38-8 | 2A-9043831 |
| 1,1,1-Trimethoxy-2-methylpropane | 52698-46-1 | 2A-9043833 |
| 4'-Butyl-4-biphenylcarbonitrile | 52709-83-8 | 2A-9043836 |
| 4-Cyano-4'-octylbiphenyl | 52709-84-9 | 2A-9043837 |
| 4-Propoxy-[1,1'-biphenyl]-4'-carbonitrile | 52709-86-1 | 2A-9043838 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA