| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52629-46-6 |
| Catalog No. | 2A-9043819 |
| Chinese Name | 2,4,6-三甲基苯乙酸 |
| Synonyms | Mesitylacetic acid; Mesity aceti acid |
| Molecular Formula | C11H13O1Cl1 |
| Molecular Weight | 196.68 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 312.9±11.0 °C at 760 mmHg |
| Melting Point | 167-168ºC |
| HTC | 2915900090 |
| PubChem ID | 16094306 |
| MDL Number | MFCD16879087 |
| SMILES | Cc1cc(C)c(CC(=O)Cl)c(C)c1 |
| InChI | InChI=1S/C11H13ClO/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3 |
| InChI Key | NXCYVLQDRHQRHC-UHFFFAOYSA-N |
| MSDS | msds/43819_1_52629_46_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl sarcosinate hydrochloride | 52605-49-9 | 2A-9043809 |
| Rubescensin B | 52617-37-5 | 2A-9043815 |
| Perfluoro-compound FC-77 | 52623-00-4 | 2A-9043816 |
| 2-Hydroxyethyl methacrylate phosphate | 52628-03-2 | 2A-9043817 |
| Thiamphenicol palmitate | 52628-58-7 | 2A-9043818 |
| Kirenol | 52659-56-0 | 2A-9043822 |
| 2-Ethynylaniline | 52670-38-9 | 2A-9043824 |
| 4-Amino-3-chlorophenol hydrochloride | 52671-64-4 | 2A-9043825 |
| Octan-2-yl 2-cyanoacetate | 52688-08-1 | 2A-9043829 |
| 4-Iodo-2-nitroanisole | 52692-09-8 | 2A-9043830 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS