
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52617-37-5 |
| Catalog No. | 2A-9043815 |
| Chinese Name | 冬凌草乙素 |
| Synonyms | (1α,5β,6β,7β,8α,9β,10α,14S,20S)-1,6,7-Trihydroxy-7,20:14,20-diepoxykaur-16-en-15-one; Rubescensin B |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.417 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 580.9±50.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8℃ |
| Application | Ponicidin (Rubescensine B) is a diterpene derived from Rubescens oryzae that has immunomodulatory, anti-inflammatory, antiviral and anti-cancer effects. Ponicidin (Rubescensine B) can induce apoptosis |
| PubChem ID | 135126302 |
| SMILES | C=C1C(=O)C23C4OC5OC2(O)C(O)C2C(C)(C)CCC(O)C52C3CCC14 |
| InChI | InChI=1S/C20H26O6/c1-8-9-4-5-10-18-11(21)6-7-17(2,3)12(18)14(23)20(24)19(10,13(8)22)15(9)25-16(18)26-20/h9-12,14-16,21,23-24H,1,4-7H2,2-3H3/t9-,10-,11-,12+,14-,15-,16-,18?,19-,20+/m0/s1 |
| InChI Key | WHRDRHNMTIXZNY-ISUYKJBHSA-N |
| MSDS | msds/43815_1_52617_37_5.pdf |
| Transport Info | Product name: Rubescens oridonin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[Bis(2-hydroxyethyl)amino]-5-nitrophenol | 52551-67-4 | 2A-9043796 |
| 3-(Acetamidomethylthio)propanoic acid | 52574-08-0 | 2A-9043802 |
| 2-(Methylamino)nicotinonitrile | 52583-87-6 | 2A-9043803 |
| 3-Ethoxyacetophenone | 52600-91-6 | 2A-9043806 |
| Ethyl sarcosinate hydrochloride | 52605-49-9 | 2A-9043809 |
| Perfluoro-compound FC-77 | 52623-00-4 | 2A-9043816 |
| 2-Hydroxyethyl methacrylate phosphate | 52628-03-2 | 2A-9043817 |
| Thiamphenicol palmitate | 52628-58-7 | 2A-9043818 |
| Mesitylacetyl chloride | 52629-46-6 | 2A-9043819 |
| Kirenol | 52659-56-0 | 2A-9043822 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA