
CAS Number52709-83-8
Synonyms4'-Butyl(1,1'-biphenyl)-4-carbonitrile; 4-n-butyl-4'-cyanobiphenyl; 4'-Butyl-[1,1'-Biphenyl]-4-carbonitrile; EINECS 258-119-0; 4-n-pentyl-4'-cyanobiphenyl; 4'-Butyl-4-biphenylcarbonitrile; 4-n-Butyl-4′-cyanobiphenyl; 4'-Butyl[1,1'-biphenyl]-4-carbonitrile; MFCD00506009; 4-n-octyl-4'-cyanobiphenyl; 4-BUTYL-4'-CYANOBIPHENYL; 4'-Butylbiphenyl-4-carbonitrile; 4-cyano-4'-butylbiphenyl; 4'-Butylbiphenyl-4-carbonitril; 4-Pentyl-4'-cyanobiphenyl; 4-Butyl-4'-cyanobiphenyl
Molecular FormulaCH3(CH2)7C6H4C6H4CN
Molecular Weight291.43
Purity98%
Density1.0±0.1 g/cm3
Boiling Point380.9±31.0 °C at 760 mmHg
Melting Point49-51°C
Appearanceliquid crystal (nematic)
EINECS258-120-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52709-83-8 |
| Catalog No. | 2A-9043836 |
| Chinese Name | 4-正-丁基-4-氰基联苯 |
| Synonyms | 4'-Butyl(1,1'-biphenyl)-4-carbonitrile; 4-n-butyl-4'-cyanobiphenyl; 4'-Butyl-[1,1'-Biphenyl]-4-carbonitrile; EINECS 258-119-0; 4-n-pentyl-4'-cyanobiphenyl; 4'-Butyl-4-biphenylcarbonitrile; 4-n-Butyl-4′-cyanobiphenyl; 4'-Butyl[1,1'-biphenyl]-4-carbonitrile; MFCD00506009; 4-n-octyl-4'-cyanobiphenyl; 4-BUTYL-4'-CYANOBIPHENYL; 4'-Butylbiphenyl-4-carbonitrile; 4-cyano-4'-butylbiphenyl; 4'-Butylbiphenyl-4-carbonitril; 4-Pentyl-4'-cyanobiphenyl; 4-Butyl-4'-cyanobiphenyl |
| Molecular Formula | CH3(CH2)7C6H4C6H4CN |
| Molecular Weight | 291.43 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 380.9±31.0 °C at 760 mmHg |
| Melting Point | 49-51°C |
| Appearance | liquid crystal (nematic) |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| EINECS | 258-120-6 |
| HTC | 2926909090 |
| PubChem ID | 24860562 |
| MDL Number | MFCD00075146 |
| SMILES | CCCCCCCCc1ccc(cc1)-c2ccc(cc2)C#N |
| InChI | 1S/C21H25N/c1-2-3-4-5-6-7-8-18-9-13-20(14-10-18)21-15-11-19(17-22)12-16-21/h9-16H,2-8H2,1H3 |
| InChI Key | CSQPODPWWMOTIY-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| Hazard Symbols | 6.1 |
| MSDS | msds/43836_1_52709_83_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-3-chlorophenol hydrochloride | 52671-64-4 | 2A-9043825 |
| Octan-2-yl 2-cyanoacetate | 52688-08-1 | 2A-9043829 |
| 4-Iodo-2-nitroanisole | 52692-09-8 | 2A-9043830 |
| Disperse Violet 93 | 52697-38-8 | 2A-9043831 |
| 1,1,1-Trimethoxy-2-methylpropane | 52698-46-1 | 2A-9043833 |
| 4-Cyano-4'-octylbiphenyl | 52709-84-9 | 2A-9043837 |
| 4-Propoxy-[1,1'-biphenyl]-4'-carbonitrile | 52709-86-1 | 2A-9043838 |
| 4-Butoxy-[1,1'-biphenyl]-4'-carbonitrile | 52709-87-2 | 2A-9043839 |
| 6-Hydroxyl-2-tetralone | 52727-28-3 | 2A-9043843 |
| Bathophenanthrolinedisulfonic acid disodium salt | 52746-49-3 | 2A-9043845 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA