
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52328-48-0 |
| Catalog No. | 2A-9043734 |
| Chinese Name | 4-叔丁基-2-甲氧基苯甲酸 |
| Synonyms | 4-t-butyl-2-methoxybenzoic acid; AC-4637; 2-methoxy-4-tert-butylbenzoic acid |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Purity | 98.00 |
| Density | 1.081 g/cm3 |
| Boiling Point | 314.183ºC at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918990090 |
| PubChem ID | 37463578 |
| SMILES | COc1cc(C(C)(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C12H16O3/c1-12(2,3)8-5-6-9(11(13)14)10(7-8)15-4/h5-7H,1-4H3,(H,13,14) |
| InChI Key | PUENGTBOCOAFKL-UHFFFAOYSA-N |
| MSDS | msds/43734_1_52328_48_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl 3-methylpent-2-enedioate | 52313-87-8 | 2A-0201736 |
| 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride | 52314-67-7 | 2A-9043725 |
| (3-Phenoxyphenyl)glycolonitrile | 52315-06-7 | 2A-9043726 |
| N'-Laruoyl-L-lysine | 52315-75-0 | 2A-9043728 |
| L-Lysine acetate | 52315-92-1 | 2A-9043729 |
| 2-Hydrazinobenzoic acid hydrochloride | 52356-01-1 | 2A-9043740 |
| 1,3-Dibromonaphthalene | 52358-73-3 | 2A-9043741 |
| (Cyclopentylthio)acetic acid | 52363-14-1 | 2A-9043742 |
| 4-Pentyloxy-[1,1'-biphenyl]-4'-carbonitrile | 52364-71-3 | 2A-9043743 |
| 4'-Heptyloxy-4-cyanobiphenyl | 52364-72-4 | 2A-9043744 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA