
CAS Number52315-92-1
Synonymsacide 2,6-diaminohexanoïque - acide acétique (1:1); Lysine, acetate (1:1); L-LYS AC; MFCD00039069; Lysine Acetate; H-LYS-OH ACOH; L-Lysine Acetate Salt; 2,6-Diaminohexansäureacetat; 2,6-diaminohexanoic acid acetate; L-LYSINE AC; Lysine acetate (1:1)
Molecular FormulaC8H18N2O4
Molecular Weight206.24
Purity98.00%
Density1.125g/cm3
Boiling Point311.5ºC at 760mmHg
Melting Point61-63 °C(lit.)
AppearanceWhite to off-white powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52315-92-1 |
| Catalog No. | 2A-9043729 |
| Chinese Name | 赖氨酸醋酸盐 |
| Synonyms | acide 2,6-diaminohexanoïque - acide acétique (1:1); Lysine, acetate (1:1); L-LYS AC; MFCD00039069; Lysine Acetate; H-LYS-OH ACOH; L-Lysine Acetate Salt; 2,6-Diaminohexansäureacetat; 2,6-diaminohexanoic acid acetate; L-LYSINE AC; Lysine acetate (1:1) |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 |
| Purity | 98.00 |
| Density | 1.125g/cm3 |
| Boiling Point | 311.5ºC at 760mmHg |
| Melting Point | 61-63 °C(lit.) |
| Appearance | White to off-white powder |
| Storage Condition | room temperature |
| HTC | 2922419000 |
| PubChem ID | 329750271 |
| InChI | InChI=1S/C14H8N2/c15-9-13-7-12(8-14(13)10-16)11-5-3-1-2-4-6-11/h1-8H |
| InChI Key | APOOSRNNXRVSDM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl butylacetylaminopropionate | 52304-36-6 | 2A-9043722 |
| Dimethyl 3-methylpent-2-enedioate | 52313-87-8 | 2A-0201736 |
| 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride | 52314-67-7 | 2A-9043725 |
| (3-Phenoxyphenyl)glycolonitrile | 52315-06-7 | 2A-9043726 |
| N'-Laruoyl-L-lysine | 52315-75-0 | 2A-9043728 |
| 4-tert-Butyl-2-methoxybenzoic acid | 52328-48-0 | 2A-9043734 |
| 2-Hydrazinobenzoic acid hydrochloride | 52356-01-1 | 2A-9043740 |
| 1,3-Dibromonaphthalene | 52358-73-3 | 2A-9043741 |
| (Cyclopentylthio)acetic acid | 52363-14-1 | 2A-9043742 |
| 4-Pentyloxy-[1,1'-biphenyl]-4'-carbonitrile | 52364-71-3 | 2A-9043743 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA