
CAS Number52315-75-0
SynonymsN-LAUROYL-L-LYSINE; N-(1-oxododecyl)-L-lysine; N-6-Lauroyl-L-lysine; monolauroyl lysine; N6-Dodecanoyl-L-lysine; lauroyllysine; n6-(1-oxododecyl)-l-lysin; N-Dodecanoyl-L-lysine; N6-Lauroyllysine
Molecular FormulaC18H36O3N2
Molecular Weight328.5
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point526.0±45.0 °C at 760 mmHg
Melting Point229-231ºC
AppearanceWhite to off-white solid with a unique light odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52315-75-0 |
| Catalog No. | 2A-9043728 |
| Chinese Name | 月桂酰赖氨酸 |
| Synonyms | N-LAUROYL-L-LYSINE; N-(1-oxododecyl)-L-lysine; N-6-Lauroyl-L-lysine; monolauroyl lysine; N6-Dodecanoyl-L-lysine; lauroyllysine; n6-(1-oxododecyl)-l-lysin; N-Dodecanoyl-L-lysine; N6-Lauroyllysine |
| Molecular Formula | C18H36O3N2 |
| Molecular Weight | 328.5 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 526.0±45.0 °C at 760 mmHg |
| Melting Point | 229-231ºC |
| Appearance | White to off-white solid with a unique light odor |
| Storage Condition | 2-8°C |
| HTC | 2924199090 |
| PubChem ID | 10233290 |
| MDL Number | MFCD09954506 |
| SMILES | CCCCCCCCCCCC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C18H36N2O3/c1-2-3-4-5-6-7-8-9-10-14-17(21)20-15-12-11-13-16(19)18(22)23/h16H,2-15,19H2,1H3,(H,20,21)(H,22,23)/t16-/m0/s1 |
| InChI Key | GYDYJUYZBRGMCC-INIZCTEOSA-N |
| MSDS | msds/43728_1_52315_75_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-2,5-dimethoxy-N-phenylbenzenesulphonamide | 52298-44-9 | 2A-9043721 |
| Ethyl butylacetylaminopropionate | 52304-36-6 | 2A-9043722 |
| Dimethyl 3-methylpent-2-enedioate | 52313-87-8 | 2A-0201736 |
| 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride | 52314-67-7 | 2A-9043725 |
| (3-Phenoxyphenyl)glycolonitrile | 52315-06-7 | 2A-9043726 |
| L-Lysine acetate | 52315-92-1 | 2A-9043729 |
| 4-tert-Butyl-2-methoxybenzoic acid | 52328-48-0 | 2A-9043734 |
| 2-Hydrazinobenzoic acid hydrochloride | 52356-01-1 | 2A-9043740 |
| 1,3-Dibromonaphthalene | 52358-73-3 | 2A-9043741 |
| (Cyclopentylthio)acetic acid | 52363-14-1 | 2A-9043742 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA