
CAS Number22422-21-5
Synonyms3-Chlor-1-(4-methylphenyl)propan-1-on; 3-Chlor-1-p-tolyl-propan-1-on; MFCD00028195; 3-Chloro-1-(4-methylphenyl)-1-propanone; 4'-Methyl-3-chloropropiophenone; 3-chloro-1-p-tolylpropan-1-one; 3-Chloro-4'-methylpropiophenone; 3-chloro-1-(4-methylphenyl)propan-1-one
Molecular FormulaC10H11ClO
Molecular Weight182.647
Purity98%
Density1.1±0.1 g/cm3
Boiling Point288.1±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22422-21-5 |
| Catalog No. | 2A-9004357 |
| Chinese Name | 3-氯-4'-甲基苯丙酮 |
| Synonyms | 3-Chlor-1-(4-methylphenyl)propan-1-on; 3-Chlor-1-p-tolyl-propan-1-on; MFCD00028195; 3-Chloro-1-(4-methylphenyl)-1-propanone; 4'-Methyl-3-chloropropiophenone; 3-chloro-1-p-tolylpropan-1-one; 3-Chloro-4'-methylpropiophenone; 3-chloro-1-(4-methylphenyl)propan-1-one |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.647 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 288.1±23.0 °C at 760 mmHg |
| Storage Condition | Room Temperature |
| HTC | 2914700090 |
| SMILES | Cc1ccc(C(=O)CCCl)cc1 |
| InChI | InChI=1S/C10H11ClO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-5H,6-7H2,1H3 |
| InChI Key | DAOWEVLVOUMCEY-UHFFFAOYSA-N |
| MSDS | msds/4357_1_22422_21_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-fluorothiophenol | 60811-23-6 | 2A-9004349 |
| 3-Chloro-4-methylbenzenesulphonyl chloride | 42413-03-6 | 2A-9004353 |
| 3-Chloro-4-methylbenzonitrile | 21423-81-4 | 2A-9004354 |
| 3-Chloro-4-methylbenzylamine | 67952-93-6 | 2A-9004355 |
| 3-Chloro-4-methylphenylhydrazine hydrochloride | 54812-56-5 | 2A-9004356 |
| 3-Chloro-5-fluoroanisole | 202925-08-4 | 2A-9004362 |
| 3'-Chloroacetophenone | 99-02-5 | 2A-9004366 |
| 3-Chlorobenzeneacetonitrile | 1529-41-5 | 2A-9004367 |
| 3-Chlorobenzenecarbothioamide | 2548-79-0 | 2A-9004368 |
| 3-Chlorobenzenesulphonyl chloride | 2888-06-4 | 2A-9004369 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA