
CAS Number60811-23-6
Synonyms3-Chloro-4-fluorothiophenol; SHR CG DF; MFCD00052938; 3-chloro-4-fluorobenzene-1-thiol; 3-Chloro-4-fluorobenzenethiol
Molecular FormulaC6H4Cl1S1F1
Molecular Weight162.61
Purity97%
Density1.4±0.1 g/cm3
Boiling Point209.2±20.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60811-23-6 |
| Catalog No. | 2A-9004349 |
| Chinese Name | 3-氯-4-氟苯硫酚 |
| Synonyms | 3-Chloro-4-fluorothiophenol; SHR CG DF; MFCD00052938; 3-chloro-4-fluorobenzene-1-thiol; 3-Chloro-4-fluorobenzenethiol |
| Molecular Formula | C6H4Cl1S1F1 |
| Molecular Weight | 162.61 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 209.2±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Under dry gas handling, store in a sealed containe |
| HTC | 2930909090 |
| MDL Number | MFCD00052938 |
| SMILES | Fc1ccc(S)cc1Cl |
| InChI | InChI=1S/C6H4ClFS/c7-5-3-4(9)1-2-6(5)8/h1-3,9H/p-1 |
| InChI Key | SFSHSIFYTWIGSF-UHFFFAOYSA-N |
| MSDS | msds/4349_1_60811_23_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-fluorophenol | 2613-23-2 | 2A-9004342 |
| 3-Chloro-4-fluorophenylacetic acid | 705-79-3 | 2A-9004344 |
| 3-Chloro-4-fluorophenylhydrazine | 84282-78-0 | 2A-9004346 |
| 3-Chloro-4-fluorophenylhydrazine hydrochloride | 175135-74-7 | 2A-9004347 |
| 3-Chloro-4'-fluoropropiophenone | 347-93-3 | 2A-9004348 |
| 3-Chloro-4-methylbenzenesulphonyl chloride | 42413-03-6 | 2A-9004353 |
| 3-Chloro-4-methylbenzonitrile | 21423-81-4 | 2A-9004354 |
| 3-Chloro-4-methylbenzylamine | 67952-93-6 | 2A-9004355 |
| 3-Chloro-4-methylphenylhydrazine hydrochloride | 54812-56-5 | 2A-9004356 |
| 3-Chloro-4'-methylpropiophenone | 22422-21-5 | 2A-9004357 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA