
CAS Number67952-93-6
Synonyms1-(3-Chloro-4-methylphenyl)methanamine; MFCD00014816; EINECS 267-929-3; (3-chloro-4-methylphenyl)methanamine; 3-Chloro-4-methylbenzylamine
Molecular FormulaC8H10ClN
Molecular Weight155.625
Purity97%
Density1.1±0.1 g/cm3
Boiling Point236.7±25.0 °C at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67952-93-6 |
| Catalog No. | 2A-9004355 |
| Chinese Name | 3-氯-4-甲基苄胺 |
| Synonyms | 1-(3-Chloro-4-methylphenyl)methanamine; MFCD00014816; EINECS 267-929-3; (3-chloro-4-methylphenyl)methanamine; 3-Chloro-4-methylbenzylamine |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.625 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 236.7±25.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2921499090 |
| SMILES | Cc1ccc(CN)cc1Cl |
| InChI | InChI=1S/C8H10ClN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| InChI Key | MXIGALIASISPNU-UHFFFAOYSA-N |
| MSDS | msds/4355_1_67952_93_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-fluorophenylhydrazine hydrochloride | 175135-74-7 | 2A-9004347 |
| 3-Chloro-4'-fluoropropiophenone | 347-93-3 | 2A-9004348 |
| 3-Chloro-4-fluorothiophenol | 60811-23-6 | 2A-9004349 |
| 3-Chloro-4-methylbenzenesulphonyl chloride | 42413-03-6 | 2A-9004353 |
| 3-Chloro-4-methylbenzonitrile | 21423-81-4 | 2A-9004354 |
| 3-Chloro-4-methylphenylhydrazine hydrochloride | 54812-56-5 | 2A-9004356 |
| 3-Chloro-4'-methylpropiophenone | 22422-21-5 | 2A-9004357 |
| 3-Chloro-5-fluoroanisole | 202925-08-4 | 2A-9004362 |
| 3'-Chloroacetophenone | 99-02-5 | 2A-9004366 |
| 3-Chlorobenzeneacetonitrile | 1529-41-5 | 2A-9004367 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA