
CAS Number51554-93-9
Synonyms1-Bromo-4-octylbenzene; ER D8; p-Bromophenyloctane; 1-(p-Bromophenyl)octane; MFCD00038348; 1-BroMo-4-n-octylbenzene
Molecular FormulaC14H21Br
Molecular Weight269.22
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point313.7±11.0 °C at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51554-93-9 |
| Catalog No. | 2A-9043515 |
| Chinese Name | 1-溴-4-正辛基苯 |
| Synonyms | 1-Bromo-4-octylbenzene; ER D8; p-Bromophenyloctane; 1-(p-Bromophenyl)octane; MFCD00038348; 1-BroMo-4-n-octylbenzene |
| Molecular Formula | C14H21Br |
| Molecular Weight | 269.22 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 313.7±11.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2903999090 |
| PubChem ID | 3210903 |
| SMILES | CCCCCCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21Br/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12H,2-8H2,1H3 |
| InChI Key | OOZQSVXPBCINJF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-(methylthio)butyrate | 51534-66-8 | 2A-9043507 |
| 2-Chloro-5-methylsulfanylbenzoic acid | 51546-12-4 | 2A-9043511 |
| 1-Aminonaphthalene-6-sulfonic acid | 51548-48-2 | 2A-9043512 |
| (Dimethylamino)acetyl chloride | 51552-16-0 | 2A-9043513 |
| 2-(Ethylamino)propiophenone hydrochloride | 51553-17-4 | 2A-9043514 |
| Citronellyl nitrile | 51566-62-2 | 2A-9043518 |
| 4,6-Dioxoheptanoic acid | 51568-18-4 | 2A-9043519 |
| 9,10-Bis(phenylethynyl)-2-methylanthracene | 51580-23-5 | 2A-9043520 |
| Sodium dichloroisocyanurate dihydrate | 51580-86-0 | 2A-9043521 |
| 3-(2-Methylquinolin-1-ium-1-yl)propane-1-sulfonate | 51583-69-8 | 2A-9043524 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA