
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51548-48-2 |
| Catalog No. | 2A-9043512 |
| Chinese Name | 混合克利夫酸 |
| Synonyms | Mixed Naphthylamine Sulfonic Acid |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 |
| Purity | ≥97.0 (acidimetric) |
| Density | 1.502 g/cm3 |
| Melting Point | 240-241 °C |
| Appearance | powder |
| HTC | 2921450090 |
| PubChem ID | 71175 |
| MDL Number | MFCD00004027 |
| SMILES | [S](=O)(=O)(O)c1c2c(c(cc1)N)cccc2 |
| InChI | 1S/C10H9NO3S/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h1-6H,11H2,(H,12,13,14) |
| InChI Key | NRZRRZAVMCAKEP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352106 |
| MSDS | msds/43512_1_51548_48_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[[Bis(2-hydroxyethyl)amino]methyl]phenol | 51527-96-9 | 2A-9043502 |
| 4-[[Bis(2-hydroxyethyl)amino]methyl]phenol | 51527-97-0 | 2A-9043503 |
| Flupenthixol dihydrochloride | 51529-01-2 | 2A-9043504 |
| Methyl 2-(methylthio)butyrate | 51534-66-8 | 2A-9043507 |
| 2-Chloro-5-methylsulfanylbenzoic acid | 51546-12-4 | 2A-9043511 |
| (Dimethylamino)acetyl chloride | 51552-16-0 | 2A-9043513 |
| 2-(Ethylamino)propiophenone hydrochloride | 51553-17-4 | 2A-9043514 |
| 1-(4-Bromophenyl)octane | 51554-93-9 | 2A-9043515 |
| Citronellyl nitrile | 51566-62-2 | 2A-9043518 |
| 4,6-Dioxoheptanoic acid | 51568-18-4 | 2A-9043519 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA