
CAS Number41876-70-4
SynonymsN,N-diethyl-4-ethynylbenzenamine; 4-(diethylamino)-ethynylbenzene; 4-N,N-diethylaminophenylethyne; MFCD00168817; N,N-Diethyl-4-ethynylaniline; p-N,N-diethylaminophenylethyne; 4'-Diethylaminophenyl acetylene; n,n-diethyl-4-ethynylbenezeamine; 4-(N,N-diethylamino)phenylacetylene; diethyl-(4-ethynyl-phenyl)-amine
Molecular FormulaC12H15N1
Molecular Weight173.26
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point264.8±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41876-70-4 |
| Catalog No. | 2A-9042878 |
| Chinese Name | 4'-二乙基氨基苯乙炔 |
| Synonyms | N,N-diethyl-4-ethynylbenzenamine; 4-(diethylamino)-ethynylbenzene; 4-N,N-diethylaminophenylethyne; MFCD00168817; N,N-Diethyl-4-ethynylaniline; p-N,N-diethylaminophenylethyne; 4'-Diethylaminophenyl acetylene; n,n-diethyl-4-ethynylbenezeamine; 4-(N,N-diethylamino)phenylacetylene; diethyl-(4-ethynyl-phenyl)-amine |
| Molecular Formula | C12H15N1 |
| Molecular Weight | 173.26 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 264.8±23.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2921420090 |
| PubChem ID | 16532911 |
| MDL Number | MFCD00168817 |
| SMILES | C#Cc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C12H15N/c1-4-11-7-9-12(10-8-11)13(5-2)6-3/h1,7-10H,5-6H2,2-3H3 |
| InChI Key | CBCACOCJKPPSMS-UHFFFAOYSA-N |
| MSDS | msds/42878_1_41876_70_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cresyl Violet perchlorate | 41830-80-2 | 2A-9042867 |
| 4-Hydroxy-3-nitrobenzyl alcohol | 41833-13-0 | 2A-9042868 |
| Methyl 4-bromophenylacetate | 41841-16-1 | 2A-9042871 |
| N-(4-Chlorobenzoyl)-tyramine | 41859-57-8 | 2A-9042873 |
| 2-Methylbenzhydryl chloride | 41870-52-4 | 2A-9042877 |
| Oxyprothepin 5,8-disulfide | 41931-98-0 | 2A-9042880 |
| 2-(4-Chlorophenylthio)acetophenone | 41932-35-8 | 2A-9042881 |
| N1-Methyl-4-nitrobenzene-1,2-diamine | 41939-61-1 | 2A-9042882 |
| Sodium tauroglycocholate | 41945-48-6 | 2A-9042883 |
| 2-(3,4-Dichlorophenyl)-2-oxoethylamine hydrochloride | 41995-19-1 | 2A-9042887 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA