
CAS Number41859-57-8
SynonymsN-(4-Chlorobenzoyl)-tyramine; N-(4-Chlorobenzoyl)tyramine; N1-(4-hydroxyphenethyl)-4-chlorobenzamide; 4-Chloro-N-(4-hydroxyphenethyl)benzamide; EINECS 255-566-3; MFCD00218513; 4-Chloro-N-[2-(4-hydroxyphenyl)ethyl]benzamide
Molecular FormulaC15H14ClNO2
Molecular Weight275.73
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point505.4±40.0 °C at 760 mmHg
Melting Point170-1720C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41859-57-8 |
| Catalog No. | 2A-9042873 |
| Chinese Name | 4-氯-N-[2-(4-羟基苯基)乙基]苯甲酰胺 |
| Synonyms | N-(4-Chlorobenzoyl)-tyramine; N-(4-Chlorobenzoyl)tyramine; N1-(4-hydroxyphenethyl)-4-chlorobenzamide; 4-Chloro-N-(4-hydroxyphenethyl)benzamide; EINECS 255-566-3; MFCD00218513; 4-Chloro-N-[2-(4-hydroxyphenyl)ethyl]benzamide |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 505.4±40.0 °C at 760 mmHg |
| Melting Point | 170-1720C |
| Appearance | solid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2924299090 |
| PubChem ID | 3258962 |
| MDL Number | MFCD00218513 |
| SMILES | ClC1=CC=C(C(NCCC2=CC=C(O)C=C2)=O)C=C1 |
| InChI | 1S/C15H14ClNO2/c16-13-5-3-12(4-6-13)15(19)17-10-9-11-1-7-14(18)8-2-11/h1-8,18H,9-10H2,(H,17,19) |
| InChI Key | ZTLWJYCDAXUIBK-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/42873_1_41859_57_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Allyl thiopropionate | 41820-22-8 | 2A-9042865 |
| Trepibutone | 41826-92-0 | 2A-9042866 |
| Cresyl Violet perchlorate | 41830-80-2 | 2A-9042867 |
| 4-Hydroxy-3-nitrobenzyl alcohol | 41833-13-0 | 2A-9042868 |
| Methyl 4-bromophenylacetate | 41841-16-1 | 2A-9042871 |
| 2-Methylbenzhydryl chloride | 41870-52-4 | 2A-9042877 |
| 4'-Diethylaminophenyl acetylene | 41876-70-4 | 2A-9042878 |
| Oxyprothepin 5,8-disulfide | 41931-98-0 | 2A-9042880 |
| 2-(4-Chlorophenylthio)acetophenone | 41932-35-8 | 2A-9042881 |
| N1-Methyl-4-nitrobenzene-1,2-diamine | 41939-61-1 | 2A-9042882 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA