
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41374-20-3 |
| Catalog No. | 2A-9042781 |
| Chinese Name | 4-甲氧基-2,2',4'-三甲基二苯胺 |
| Synonyms | 2-methyl-4-methoxy-2',4'-dimethyl-diphenylamine; 4-methoxy-2,2',4'-trimethyldiphenylamine; 4-Methoxy-2,2',4'-trimethyl-diphenylamin |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.6 |
| Purity | 98.00 |
| Density | 1.057g/cm3 |
| Boiling Point | 369.7ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 29625937 |
| MDL Number | MFCD03940573 |
| SMILES | COc1ccc(Nc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C16H19NO/c1-11-5-7-15(12(2)9-11)17-16-8-6-14(18-4)10-13(16)3/h5-10,17H,1-4H3 |
| InChI Key | ICYDPYVGYFLVFS-UHFFFAOYSA-N |
| MSDS | msds/42781_1_41374_20_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methoxymethyldiphenylamine | 41317-15-1 | 2A-9042769 |
| 4-Chlorotryptophol | 41340-30-1 | 2A-9042772 |
| Aluminium glycinate | 41354-48-7 | 2A-9042775 |
| alpha-Sulfophenylacetic acid | 41360-32-1 | 2A-9042776 |
| 3-(Benzooxazol-2-yl)phenylamine | 41373-36-8 | 2A-9042780 |
| 7H-Dodecafluoroheptanoyl chloride | 41405-35-0 | 2A-9042785 |
| 4'-(Hexyloxy)-4-biphenylcarbonitrile | 41424-11-7 | 2A-9042786 |
| Ethyl 6,8-dichloro caprylate | 41443-60-1 | 2A-9042788 |
| Cefsulodin sodium | 41444-66-0 | 2A-9042790 |
| Turkesterone | 41451-87-0 | 2A-9042791 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA