
CAS Number41451-87-0
SynonymsTURKESTERONE(SH); (2β,3β,5β,11α,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one; (2beta,3beta,5beta,11alpha,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one
Molecular FormulaC27H44O8
Molecular Weight496.63
Purity≥90.0 (HPLC)%
Density1.3±0.1 g/cm3
Boiling Point740.1±60.0 °C at 760 mmHg
Appearancesolid
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41451-87-0 |
| Catalog No. | 2A-9042791 |
| Chinese Name | 土克甾酮 |
| Synonyms | TURKESTERONE(SH); (2β,3β,5β,11α,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one; (2beta,3beta,5beta,11alpha,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.63 |
| Purity | ≥90.0 (HPLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 740.1±60.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C |
| Application | Turkesterone Isolated from Ajuga turkestanica, Turkesterone is a potent ecdysone that acts as an ecdysteroid receptor (EcR) agonist in some insect systems. |
| PubChem ID | 36570747 |
| MDL Number | MFCD04307740 |
| SMILES | O[C@H]1[C@@H](O)C[C@@]2(C)[C@@](C(C=C3[C@]2([H])[C@H](O)C[C@@]4(C)[C@]3(CC[C@]4([H])[C@@]([C@H](O)CCC(O)(C)C)(C)O)O)=O)([H])C1 |
| InChI | 1S/C27H44O8/c1-23(2,33)8-7-21(32)26(5,34)20-6-9-27(35)15-11-16(28)14-10-17(29)18(30)12-24(14,3)22(15)19(31)13-25(20,27)4/h11,14,17-22,29-35H,6-10,12-13H2,1-5H3/t14-,17+,18-,19+,20-,21+,22+,24-,25+,26+,27+/m0/s1 |
| InChI Key | WSBAGDDNVWTLOM-XHZKDPLLSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/42791_1_41451_87_0.pdf |
| Transport Info | Product Name: Tuxerone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxy-2,2',4'-trimethyldiphenylamine | 41374-20-3 | 2A-9042781 |
| 7H-Dodecafluoroheptanoyl chloride | 41405-35-0 | 2A-9042785 |
| 4'-(Hexyloxy)-4-biphenylcarbonitrile | 41424-11-7 | 2A-9042786 |
| Ethyl 6,8-dichloro caprylate | 41443-60-1 | 2A-9042788 |
| Cefsulodin sodium | 41444-66-0 | 2A-9042790 |
| Bupirimate | 41483-43-6 | 2A-9042795 |
| 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester | 41484-35-9 | 2A-9042796 |
| Methyl 5-formyl-2-hydroxybenzoate | 41489-76-3 | 2A-9042797 |
| 1-Bromo-4-butylbenzene | 41492-05-1 | 2A-9042798 |
| N-(4-Acetylaminophenyl)-3-hydroxynaphthalene-2-carboxamide | 41506-62-1 | 2A-9042800 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA