
CAS Number41317-15-1
Synonyms4-Methoxy-2-methyldiphenylamine; 4-Methoxy-2-Methyl Diphenylamine; MFCD00272619; 4-Methoxy-2-methyldiphenylamine MMD; 2-Methyl-4-methoxydiphenylamine ACME; EINECS 255-310-0; 4-Methoxy-2-methyl-N-phenylaniline; Methoxymethyldiphenylamine
Molecular FormulaC14H15NO
Molecular Weight213.275
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point344.6±30.0 °C at 760 mmHg
Melting Point80-83°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41317-15-1 |
| Catalog No. | 2A-9042769 |
| Chinese Name | 2-甲基-4-甲氧基二苯胺 |
| Synonyms | 4-Methoxy-2-methyldiphenylamine; 4-Methoxy-2-Methyl Diphenylamine; MFCD00272619; 4-Methoxy-2-methyldiphenylamine MMD; 2-Methyl-4-methoxydiphenylamine ACME; EINECS 255-310-0; 4-Methoxy-2-methyl-N-phenylaniline; Methoxymethyldiphenylamine |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.275 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 344.6±30.0 °C at 760 mmHg |
| Melting Point | 80-83°C |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2922299090 |
| PubChem ID | 3314282 |
| SMILES | COc1ccc(Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C14H15NO/c1-11-10-13(16-2)8-9-14(11)15-12-6-4-3-5-7-12/h3-10,15H,1-2H3 |
| InChI Key | CYMPUOGZUXAIMY-UHFFFAOYSA-N |
| MSDS | msds/42769_1_41317_15_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Methoxy-2-methyldiphenylamine Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Aniline-3-beta-ethyl sulfonyl sulfate-6-sulfonic acid | 41261-80-7 | 2A-9042757 |
| 4-Methylamino-3-nitrobenzoic acid | 41263-74-5 | 2A-9042758 |
| Solvent Green 1 | 41272-40-6 | 2A-9042762 |
| 1-Benzyl-3-ethoxycarbonyl-4-piperidone | 41276-30-6 | 2A-9042764 |
| 4-Hydroxy-3-methyl-2-(2-propynyl)-2-cyclopentene-1-one | 41301-27-3 | 2A-9042767 |
| 4-Chlorotryptophol | 41340-30-1 | 2A-9042772 |
| Aluminium glycinate | 41354-48-7 | 2A-9042775 |
| alpha-Sulfophenylacetic acid | 41360-32-1 | 2A-9042776 |
| 3-(Benzooxazol-2-yl)phenylamine | 41373-36-8 | 2A-9042780 |
| 4-Methoxy-2,2',4'-trimethyldiphenylamine | 41374-20-3 | 2A-9042781 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA