
CAS Number41219-16-3
Synonyms2,3,4-Trimethoxy-benzylamin; 2,3,4-trimethoxybenzylamine; 2,3,4-Trimethoxy-benzylamine; 1-(2,3,4-Trimethoxyphenyl)methanamine; 2,3,4-Trimethoxybenzenemethanamine; 2,3,4-Trimethyloxybenzylamine; 2,4-Trimethyloxybenzylamine
Molecular FormulaC10H15NO3
Molecular Weight197.23
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point286.1±35.0 °C at 760 mmHg
AppearanceColorless to yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41219-16-3 |
| Catalog No. | 2A-9042751 |
| Chinese Name | 2,3,4-三甲氧基苄胺 |
| Synonyms | 2,3,4-Trimethoxy-benzylamin; 2,3,4-trimethoxybenzylamine; 2,3,4-Trimethoxy-benzylamine; 1-(2,3,4-Trimethoxyphenyl)methanamine; 2,3,4-Trimethoxybenzenemethanamine; 2,3,4-Trimethyloxybenzylamine; 2,4-Trimethyloxybenzylamine |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 286.1±35.0 °C at 760 mmHg |
| Appearance | Colorless to yellow transparent liquid |
| Storage Condition | room temperature |
| HTC | 2922199090 |
| PubChem ID | 520472 |
| MDL Number | C10H15NO3 |
| SMILES | COc1ccc(CN)c(OC)c1OC |
| InChI | InChI=1S/C10H15NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,6,11H2,1-3H3 |
| InChI Key | QWZMCOACPDTUIO-UHFFFAOYSA-N |
| MSDS | msds/42751_1_41219_16_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Apramycin sulfate | 41194-16-5 | 2A-9042742 |
| 1,2,3,4,4a,5,6,7-Octahydro-2,5,5-trimethyl-2-naphthol | 41199-19-3 | 2A-9042745 |
| 5-Fluoro-2-methylindan-1-one | 41201-58-5 | 2A-9042746 |
| (5-Ethyl-2-methyl-1,3,2-dioxaphosphorinan-5-yl)methyl dimethyl phosphonate P-oxide | 41203-81-0 | 2A-9042749 |
| 6-Aminomethyl-5,6-dihydromorphanthridine | 41218-84-2 | 2A-9042750 |
| 4-Methoxy-2-butanol | 41223-27-2 | 2A-9042752 |
| 2-Bromo-2-methylbutyric acid | 41242-50-6 | 2A-9042753 |
| 3-Chloro-4-iodonitrobenzene | 41252-96-4 | 2A-9042754 |
| Aniline-3-beta-ethyl sulfonyl sulfate-6-sulfonic acid | 41261-80-7 | 2A-9042757 |
| 4-Methylamino-3-nitrobenzoic acid | 41263-74-5 | 2A-9042758 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA