
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41201-58-5 |
| Catalog No. | 2A-9042746 |
| Chinese Name | 2-甲基-5-氟茚满酮 |
| Synonyms | EINECS 255-261-5; 5-fluoro-2-methyl-2,3-dihydroinden-1-one; MFCD07787592 |
| Molecular Formula | C10H9O1F1 |
| Molecular Weight | 164.18 |
| Purity | 98.00 |
| Density | 1.179g/cm3 |
| Boiling Point | 251.8ºC at 760mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914700090 |
| PubChem ID | 10041225 |
| MDL Number | MFCD07787592 |
| SMILES | CC1Cc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C10H9FO/c1-6-4-7-5-8(11)2-3-9(7)10(6)12/h2-3,5-6H,4H2,1H3 |
| InChI Key | HMJXQEIMQBPTHN-UHFFFAOYSA-N |
| MSDS | msds/42746_1_41201_58_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2,5-Dioxooxolan-3-yl)acetamide | 41148-79-2 | 2A-9042735 |
| Dimethyl (2-oxo-4-phenylbutyl)phosphonate | 41162-19-0 | 2A-9042737 |
| 8-Hydroxyjulolidine | 41175-50-2 | 2A-9042739 |
| Apramycin sulfate | 41194-16-5 | 2A-9042742 |
| 1,2,3,4,4a,5,6,7-Octahydro-2,5,5-trimethyl-2-naphthol | 41199-19-3 | 2A-9042745 |
| (5-Ethyl-2-methyl-1,3,2-dioxaphosphorinan-5-yl)methyl dimethyl phosphonate P-oxide | 41203-81-0 | 2A-9042749 |
| 6-Aminomethyl-5,6-dihydromorphanthridine | 41218-84-2 | 2A-9042750 |
| 2,3,4-Trimethoxybenzylamine | 41219-16-3 | 2A-9042751 |
| 4-Methoxy-2-butanol | 41223-27-2 | 2A-9042752 |
| 2-Bromo-2-methylbutyric acid | 41242-50-6 | 2A-9042753 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA