
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41252-96-4 |
| Catalog No. | 2A-9042754 |
| Chinese Name | 2-氯-1-碘-4-硝基苯 |
| Synonyms | 1-CHLORO-2-IODO-5-NITROBENZENE; 2-Chloro-1-iodo-4-nitrobenzene; MFCD00024589; EINECS 255-278-8 |
| Molecular Formula | C6H3ClINO2 |
| Molecular Weight | 283.454 |
| Purity | 98.00 |
| Density | 2.094g/cm3 |
| Boiling Point | 312.9ºC at 760mmHg |
| Melting Point | 94 °C |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2904909090 |
| PubChem ID | 121518 |
| MDL Number | MFCD00024589 |
| SMILES | O=[N+]([O-])c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C6H3ClINO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| InChI Key | FQXFHRSYMORXKN-UHFFFAOYSA-N |
| MSDS | msds/42754_1_41252_96_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (5-Ethyl-2-methyl-1,3,2-dioxaphosphorinan-5-yl)methyl dimethyl phosphonate P-oxide | 41203-81-0 | 2A-9042749 |
| 6-Aminomethyl-5,6-dihydromorphanthridine | 41218-84-2 | 2A-9042750 |
| 2,3,4-Trimethoxybenzylamine | 41219-16-3 | 2A-9042751 |
| 4-Methoxy-2-butanol | 41223-27-2 | 2A-9042752 |
| 2-Bromo-2-methylbutyric acid | 41242-50-6 | 2A-9042753 |
| Aniline-3-beta-ethyl sulfonyl sulfate-6-sulfonic acid | 41261-80-7 | 2A-9042757 |
| 4-Methylamino-3-nitrobenzoic acid | 41263-74-5 | 2A-9042758 |
| Solvent Green 1 | 41272-40-6 | 2A-9042762 |
| 1-Benzyl-3-ethoxycarbonyl-4-piperidone | 41276-30-6 | 2A-9042764 |
| 4-Hydroxy-3-methyl-2-(2-propynyl)-2-cyclopentene-1-one | 41301-27-3 | 2A-9042767 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA