
CAS Number38961-21-6
SynonymsO-benzyl-N-methyltyramine; 2-[4-(Benzyloxy)phenyl]-N-methylethanamine; p-benzyloxy-N-methyl-phenethylamine; para-benzyloxy-N-methyl phenethyl amine; 4-benzyloxy-N-methyl-phenylethylamine; [2-(4-Benzyloxy-phenyl)-ethyl]-meth; yl-amine
Molecular FormulaC16H19NO
Molecular Weight241.328
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point371.8±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38961-21-6 |
| Catalog No. | 2A-9042236 |
| Chinese Name | 2-(4-(苄氧基)苯基)-N-甲基乙胺 |
| Synonyms | O-benzyl-N-methyltyramine; 2-[4-(Benzyloxy)phenyl]-N-methylethanamine; p-benzyloxy-N-methyl-phenethylamine; para-benzyloxy-N-methyl phenethyl amine; 4-benzyloxy-N-methyl-phenylethylamine; [2-(4-Benzyloxy-phenyl)-ethyl]-meth; yl-amine |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.328 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 371.8±22.0 °C at 760 mmHg |
| HTC | 2922199090 |
| PubChem ID | 16820641 |
| SMILES | CNCCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19NO/c1-17-12-11-14-7-9-16(10-8-14)18-13-15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3 |
| InChI Key | BRJKEMHRRBVZST-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methoxyacetyl chloride | 38870-89-2 | 2A-9042219 |
| 1-Acetoxy-4-chloro-3-methyl-2-butene | 38872-49-0 | 2A-9042220 |
| 2-Bromo-6-nitrobenzoic acid | 38876-67-4 | 2A-9042222 |
| Somatostatin | 38916-34-6 | 2A-9042227 |
| Tetrabutylammonium tribromide | 38932-80-8 | 2A-9042229 |
| Ophiopogonin B | 38971-41-4 | 2A-9042238 |
| Oxypaeoniflora | 39011-91-1 | 2A-9042245 |
| Dimethyl nitroterephthalate | 39020-35-4 | 2A-9042247 |
| (Z)-Guggulsterone | 39025-23-5 | 2A-9042249 |
| 5-(2-Aminoethyl)-1H-imidazol-2-amine | 39050-13-0 | 2A-9042251 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA