CAS Number38916-34-6
Synonymsgrowth hormone inhibiting hormone; 15-28-Somatostatin-28; Modustatina; SS-14; Somatostatin Acetate; Somatofalk; MFCD00076762; Stilamin; GH-RIF; SRIF-A; somatotropin release inhibiting factor; SRIF; Somatostatin; Somatostatina; EINECS 256-969-7; Aminopan; ALA-GLY-CYS-LYS-ASN-PHE-PHE-TRP-LYS-THR-PHE-THR-SER-CYS: AGCKNFFWKTFTSC DISULFIDE BRIDGE CYS3-CYS14; Cyclic somatostatin
Molecular FormulaC76H104N18O19S2
Molecular Weight1637.9
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point1970.9±65.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38916-34-6 |
| Catalog No. | 2A-9042227 |
| Chinese Name | 醋酸生长抑素 |
| Synonyms | growth hormone inhibiting hormone; 15-28-Somatostatin-28; Modustatina; SS-14; Somatostatin Acetate; Somatofalk; MFCD00076762; Stilamin; GH-RIF; SRIF-A; somatotropin release inhibiting factor; SRIF; Somatostatin; Somatostatina; EINECS 256-969-7; Aminopan; ALA-GLY-CYS-LYS-ASN-PHE-PHE-TRP-LYS-THR-PHE-THR-SER-CYS: AGCKNFFWKTFTSC DISULFIDE BRIDGE CYS3-CYS14; Cyclic somatostatin |
| Molecular Formula | C76H104N18O19S2 |
| Molecular Weight | 1637.9 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1970.9±65.0 °C at 760 mmHg |
| Appearance | powder |
| Water Solubility | H2O: 1 mg/mL | Soluble in water(25,00°C 1,00 g/L), |
| Storage Condition | Sealed, store at -18 ºC |
| Application | Cyclic somatostatin is a growth hormone release inhibitor in the treatment of bleeding gastroduodenal ulcers. |
| PubChem ID | 7980634 |
| MDL Number | C76H104N18O19S2 |
| SMILES | CC(N)C(=O)NCC(=O)NC1CSSCC(C(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(Cc2ccccc2)NC(=O)C(C(C)O)NC(=O)C(CCCCN)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(N)=O)NC(=O)C(CCCCN)NC1=O |
| InChI | InChI=1S/C76H104N18O19S2/c1-41(79)64(100)82-37-61(99)83-58-39-114-115-40-59(76(112)113)92-72(108)57(38-95)91-75(111)63(43(3)97)94-71(107)54(33-46-23-11-6-12-24-46)90-74(110)62(42(2)96)93-66(102)51(28-16-18-30-78)84-69(105)55(34-47-36-81-49-26-14-13-25-48(47)49)88-68(104)53(32-45-21-9-5-10-22-45)86-67(103)52(31-44-19-7-4-8-20-44)87-70(106)56(35-60(80)98)89-65(101)50(85-73(58)109)27-15-17-29-77/h4-14,19-26,36,41-43,50-59,62-63,81,95-97H,15-18,27-35,37-40,77-79H2,1-3H3,(H2,80,98)(H,82,100)(H,83,99)(H,84,105)(H,85,109)(H,86,103)(H,87,106)(H,88,104)(H,89,101)(H,90,110)(H,91,111)(H,92,108)(H,93,102)(H,94,107)(H,112,113) |
| InChI Key | NHXLMOGPVYXJNR-ATOGVRKGSA-N |
| MSDS | msds/42227_1_38916_34_6.pdf |
| Transport Info | Product Name: Somatostatin Acetate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Hydroxy-5-methyl-2-hexanone | 38836-21-4 | 2A-9042213 |
| Trisguanidinium phosphate | 38848-02-1 | 2A-9042214 |
| Methoxyacetyl chloride | 38870-89-2 | 2A-9042219 |
| 1-Acetoxy-4-chloro-3-methyl-2-butene | 38872-49-0 | 2A-9042220 |
| 2-Bromo-6-nitrobenzoic acid | 38876-67-4 | 2A-9042222 |
| Tetrabutylammonium tribromide | 38932-80-8 | 2A-9042229 |
| 2-(4-(Benzyloxy)phenyl)-N-methylethanamine | 38961-21-6 | 2A-9042236 |
| Ophiopogonin B | 38971-41-4 | 2A-9042238 |
| Oxypaeoniflora | 39011-91-1 | 2A-9042245 |
| Dimethyl nitroterephthalate | 39020-35-4 | 2A-9042247 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS