
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37868-26-1 |
| Catalog No. | 2A-9042036 |
| Chinese Name | 2-茚满基乙酸 |
| Synonyms | MFCD00082653; 2-Indanylacetic acid; 2-(2,3-dihydro-1H-inden-2-yl)acetic acid |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 |
| Purity | 98.00 |
| Density | 1.169g/cm3 |
| Boiling Point | 343.28ºC at 760 mmHg |
| Melting Point | 91-93ºC |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2916399090 |
| PubChem ID | 7688984 |
| SMILES | O=C(O)CC1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H12O2/c12-11(13)7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-7H2,(H,12,13) |
| InChI Key | TULDPXYHBFBRGW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 4-chloronicotinate | 37831-62-2 | 2A-9042025 |
| 1,2-Bis(2,4,6-tribromophenoxy)ethane | 37853-59-1 | 2A-9042028 |
| 2-Perfluorohexylethyl acetate | 37858-03-0 | 2A-9042029 |
| 2-Perfluorooctylethyl acetate | 37858-04-1 | 2A-9042030 |
| 4-Bromophenylacetyl chloride | 37859-24-8 | 2A-9042031 |
| Sodium N-dodecanoyl-L-valinate | 37869-33-3 | 2A-9042037 |
| Sodium N-dodecanoyl-L-phenlyalaninate | 37869-82-2 | 2A-9042038 |
| 2-Hydrazino-6-methylpyrimidin-4-ol | 37893-08-6 | 2A-9042041 |
| Methyl 3-chloro-4-methoxybenzoate | 37908-98-8 | 2A-9042043 |
| Cimifugin | 37921-38-3 | 2A-9042046 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA