
CAS Number37853-59-1
SynonymsEINECS 253-692-3; 1,1'-[Ethane-1,2-diylbis(oxy)]bis(2,4,6-tribromobenzene); 1,1'-[Ethane-1,2-diylbis(oxy)]bis[2,4,6-tribromobenzenato(2-)]; 1,1'-[1,2-Ethanediylbis(oxy)]bis(2,4,6-tribromobenzene); 1,2-Bis(2,4,6-tribromophenoxy)ethane
Molecular FormulaC14H8Br6O2
Molecular Weight687.64
Purity98.00%
Density2.3±0.1 g/cm3
Boiling Point566.4±50.0 °C at 760 mmHg
Melting Point222-223 °C
AppearanceWhite to off-white solid or powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37853-59-1 |
| Catalog No. | 2A-9042028 |
| Chinese Name | 1,2-双(2,4,6-三溴苯氧基)乙烷 |
| Synonyms | EINECS 253-692-3; 1,1'-[Ethane-1,2-diylbis(oxy)]bis(2,4,6-tribromobenzene); 1,1'-[Ethane-1,2-diylbis(oxy)]bis[2,4,6-tribromobenzenato(2-)]; 1,1'-[1,2-Ethanediylbis(oxy)]bis(2,4,6-tribromobenzene); 1,2-Bis(2,4,6-tribromophenoxy)ethane |
| Molecular Formula | C14H8Br6O2 |
| Molecular Weight | 687.64 |
| Purity | 98.00 |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 566.4±50.0 °C at 760 mmHg |
| Melting Point | 222-223 °C |
| Appearance | White to off-white solid or powder |
| Storage Condition | 2-8°C |
| Packaging | II |
| HTC | 2909309090 |
| PubChem ID | 8175229 |
| SMILES | Brc1cc(Br)c(OCCOc2c(Br)cc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C14H8Br6O2/c15-7-3-9(17)13(10(18)4-7)21-1-2-22-14-11(19)5-8(16)6-12(14)20/h3-6H,1-2H2 |
| InChI Key | YATIGPZCMOYEGE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Fluoro-2-methylindanone | 37794-19-7 | 2A-9042020 |
| 2-Ethoxybenzylamine | 37806-29-4 | 2A-9042021 |
| 7-Hydroxy-2-tetralone | 37827-68-2 | 2A-9042022 |
| 4,5-Dimethyl-1,3-dioxol-2-one | 37830-90-3 | 2A-9042024 |
| Ethyl 4-chloronicotinate | 37831-62-2 | 2A-9042025 |
| 2-Perfluorohexylethyl acetate | 37858-03-0 | 2A-9042029 |
| 2-Perfluorooctylethyl acetate | 37858-04-1 | 2A-9042030 |
| 4-Bromophenylacetyl chloride | 37859-24-8 | 2A-9042031 |
| 2-Indanylacetic acid | 37868-26-1 | 2A-9042036 |
| Sodium N-dodecanoyl-L-valinate | 37869-33-3 | 2A-9042037 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA