
CAS Number37794-19-7
Synonyms6-Fluoro-2-methyl-1-indanone; L56 BVT&J C1 HF; 6-Fluoro-2-methylindanone; 6-Fluoro-2-methyl-2,3-dihydro-1H-inden-1-one; MFCD00029129; 6-Fluoro-2-methylindan-1-one
Molecular FormulaC10H9FO
Molecular Weight164.18
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point240.9±29.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37794-19-7 |
| Catalog No. | 2A-9042020 |
| Chinese Name | 6-氟-2-甲基-1-茚酮 |
| Synonyms | 6-Fluoro-2-methyl-1-indanone; L56 BVT&J C1 HF; 6-Fluoro-2-methylindanone; 6-Fluoro-2-methyl-2,3-dihydro-1H-inden-1-one; MFCD00029129; 6-Fluoro-2-methylindan-1-one |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 240.9±29.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914700090 |
| PubChem ID | 16544988 |
| SMILES | CC1Cc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C10H9FO/c1-6-4-7-2-3-8(11)5-9(7)10(6)12/h2-3,5-6H,4H2,1H3 |
| InChI Key | BABIQLUCYVRCIX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl D-(-)-4-hydroxy-phenylglycinate | 37763-23-8 | 2A-9042013 |
| 4-Chloro-3-nitrophenylacetic acid | 37777-68-7 | 2A-9042015 |
| 4-Chloro-2-nitrophenylacetic acid | 37777-71-2 | 2A-9042016 |
| 2-Chloro-6-fluorophenylacetic acid | 37777-76-7 | 2A-9042017 |
| 2-(4,5-Dichloro-2-nitrophenyl)acetic acid | 37777-90-5 | 2A-9042018 |
| 2-Ethoxybenzylamine | 37806-29-4 | 2A-9042021 |
| 7-Hydroxy-2-tetralone | 37827-68-2 | 2A-9042022 |
| 4,5-Dimethyl-1,3-dioxol-2-one | 37830-90-3 | 2A-9042024 |
| Ethyl 4-chloronicotinate | 37831-62-2 | 2A-9042025 |
| 1,2-Bis(2,4,6-tribromophenoxy)ethane | 37853-59-1 | 2A-9042028 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA