
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37908-98-8 |
| Catalog No. | 2A-9042043 |
| Chinese Name | 3-氯-4-甲氧基苯甲酸甲酯 |
| Synonyms | MFCD00017188; methyl 3-chloro-4-methoxybenzoate; EINECS 253-709-4 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 |
| Purity | 98.00 |
| Density | 1.228 g/cm3 |
| Boiling Point | 289ºC at 760 mmHg |
| Melting Point | 93-97 °C |
| Appearance | White to light yellow crystalline powder |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2918990090 |
| PubChem ID | 10240686 |
| SMILES | COC(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClO3/c1-12-8-4-3-6(5-7(8)10)9(11)13-2/h3-5H,1-2H3 |
| InChI Key | PINQDVFQCCFACD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromophenylacetyl chloride | 37859-24-8 | 2A-9042031 |
| 2-Indanylacetic acid | 37868-26-1 | 2A-9042036 |
| Sodium N-dodecanoyl-L-valinate | 37869-33-3 | 2A-9042037 |
| Sodium N-dodecanoyl-L-phenlyalaninate | 37869-82-2 | 2A-9042038 |
| 2-Hydrazino-6-methylpyrimidin-4-ol | 37893-08-6 | 2A-9042041 |
| Cimifugin | 37921-38-3 | 2A-9042046 |
| 5-Bromo-2-methoxyphenol | 37942-01-1 | 2A-9042048 |
| Diphenyl-2-pyridylphosphine | 37943-90-1 | 2A-9042050 |
| 3-(Dimethylamino)-1-(3-methoxyphenyl)-2-methyl-1-propanone hydrochloride | 37951-53-4 | 2A-9042051 |
| Sulfamonomethoxine sodium | 38006-08-5 | 2A-9042057 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA