
CAS Number34256-82-1
SynonymsHarness; 2-chloro-N-ethoxymethyl-2'-methyl-6'-ethyl-acetanilide; MFCD00143534; Nevirex; 2-chloro-N-ethoxymethyl-6'-ethylacet-o-toluidide; EINECS 251-899-3; Acetochlore; Azetochlor; Erunit; 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide; Acenit
Molecular FormulaC14H20ClNO2
Molecular Weight269.767
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point391.5±42.0 °C at 760 mmHg
Melting Point<0ºC
AppearanceOily liquid at room temperature, light amber to violet color, aromatic odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34256-82-1 |
| Catalog No. | 2A-9041423 |
| Chinese Name | 乙草胺 |
| Synonyms | Harness; 2-chloro-N-ethoxymethyl-2'-methyl-6'-ethyl-acetanilide; MFCD00143534; Nevirex; 2-chloro-N-ethoxymethyl-6'-ethylacet-o-toluidide; EINECS 251-899-3; Acetochlore; Azetochlor; Erunit; 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide; Acenit |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.767 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 391.5±42.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Appearance | Oily liquid at room temperature, light amber to violet color, aromatic odor |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 3808931100 |
| SMILES | CCOCN(C(=O)CCl)c1c(C)cccc1CC |
| InChI | InChI=1S/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
| InChI Key | VTNQPKFIQCLBDU-UHFFFAOYSA-N |
| MSDS | msds/41423_2_34256_82_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-Bromo-2,4-dimethoxybenzoic acid | 32246-20-1 | 2A-9041021 |
| 2,4-Dihydroxy-6-nitroquinazoline | 32618-85-2 | 2A-9041082 |
| Cholest-5-en-3beta-yl 2,4-dichlorobenzoate | 32832-01-2 | 2A-9041125 |
| N'-(2,4-Dimethylphenyl)-N-methylimidoformamide | 33089-74-6 | 2A-9041178 |
| Methyl N-2,4-dimethylphenylformimidate | 33108-52-0 | 2A-9041185 |
| (2,4-Dimethyl-1,3-thiazol-5-yl)acetic acid | 34272-65-6 | 2A-9041428 |
| Glyphosate-sodium | 34494-03-6 | 2A-9041476 |
| 2,4-Difluoropyridine | 34941-90-7 | 2A-9041581 |
| 2,4,5-Triamino-6-hydroxypyrimidine sulfate | 35011-47-3 | 2A-9041597 |
| 2,4,5-Trihydroxybenzaldehyde | 35094-87-2 | 2A-9041607 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA