
CAS Number32832-01-2
Synonymscholest-5-en-3beta-yl 2,4-dichlorobenzoate; EINECS 251-248-3; Cholesteryl; Cholesteroldichlorobenzoate; CHOLESTEROL 2,4-DICHLOROBENZOATE; Cholesteryl 2,4-Dichlorobenzoate; CHOLESTERYL 2,4-DICHLOROBEZOATE; Cholestreyl 2,4-dichlorobenzoate; MFCD07776849
Molecular FormulaC34H48Cl2O2
Molecular Weight559.65000
Purity98.00%
Density1.13 g/cm3
Boiling Point600.4ºC at 760 mmHg
Melting Point126°C
Appearancewhite crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32832-01-2 |
| Catalog No. | 2A-9041125 |
| Chinese Name | 胆固醇(2,4-二氯苯甲酸)酯 |
| Synonyms | cholest-5-en-3beta-yl 2,4-dichlorobenzoate; EINECS 251-248-3; Cholesteryl; Cholesteroldichlorobenzoate; CHOLESTEROL 2,4-DICHLOROBENZOATE; Cholesteryl 2,4-Dichlorobenzoate; CHOLESTERYL 2,4-DICHLOROBEZOATE; Cholestreyl 2,4-dichlorobenzoate; MFCD07776849 |
| Molecular Formula | C34H48Cl2O2 |
| Molecular Weight | 559.65000 |
| Purity | 98.00 |
| Density | 1.13 g/cm3 |
| Boiling Point | 600.4ºC at 760 mmHg |
| Melting Point | 126°C |
| Appearance | white crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5ccc(Cl)cc5Cl)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H48Cl2O2/c1-21(2)7-6-8-22(3)28-13-14-29-26-11-9-23-19-25(38-32(37)27-12-10-24(35)20-31(27)36)15-17-33(23,4)30(26)16-18-34(28,29)5/h9-10,12,20-22,25-26,28-30H,6-8,11,13-19H2,1-5H3/t22-,25+,26+,28-,29+,30?,33+,34-/m1/s1 |
| InChI Key | NZZFKZMKJPWVDL-XBGNAKIGSA-N |
| Hazard Symbols | 3 |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-(2-(2,4-Di-tert-pentylphenoxy)acetamido)-N-(5-oxo-1-(2,4,6-trichlorophenyl)-2-pyrazolin-3-yl)benzamide | 31188-91-7 | 2A-9040853 |
| 2,4-Dimercapto-5,6-diaminopyrimidine | 31295-41-7 | 2A-9040868 |
| Tris(2,4-ditert-butylphenyl) phosphite | 31570-04-4 | 2A-9040915 |
| 5-Bromo-2,4-dimethoxybenzoic acid | 32246-20-1 | 2A-9041021 |
| 2,4-Dihydroxy-6-nitroquinazoline | 32618-85-2 | 2A-9041082 |
| N'-(2,4-Dimethylphenyl)-N-methylimidoformamide | 33089-74-6 | 2A-9041178 |
| Methyl N-2,4-dimethylphenylformimidate | 33108-52-0 | 2A-9041185 |
| Acetochlor | 34256-82-1 | 2A-9041423 |
| (2,4-Dimethyl-1,3-thiazol-5-yl)acetic acid | 34272-65-6 | 2A-9041428 |
| Glyphosate-sodium | 34494-03-6 | 2A-9041476 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA