
CAS Number33089-74-6
SynonymsCaswell No. 119F; N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; (Ξ)-N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; (EZ)-N1-methyl-N2-(2,4-xylyl)formamidine; N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; N-(2,4-Dimethylphenyl)-N'-methylimidoformamide; semiamitraz; N-Methyl-N'-2,4-xylylformamidine; monoamitraz; (EZ)-N-methylaminomethylene-2,4-xylidine; N'-(2,4-Dimethylphenyl)-N-methylformamidine
Molecular FormulaC10H14N2
Molecular Weight162.232
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point245.9±50.0 °C at 760 mmHg
Melting Point71 - 72°C (lit.)
AppearanceColorless crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33089-74-6 |
| Catalog No. | 2A-9041178 |
| Chinese Name | 单甲脒 |
| Synonyms | Caswell No. 119F; N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; (Ξ)-N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; (EZ)-N1-methyl-N2-(2,4-xylyl)formamidine; N-(2,4-dimethylphenyl)-N'-methylmethanimidamide; N-(2,4-Dimethylphenyl)-N'-methylimidoformamide; semiamitraz; N-Methyl-N'-2,4-xylylformamidine; monoamitraz; (EZ)-N-methylaminomethylene-2,4-xylidine; N'-(2,4-Dimethylphenyl)-N-methylformamidine |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.232 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 245.9±50.0 °C at 760 mmHg |
| Melting Point | 71 - 72°C (lit.) |
| Appearance | Colorless crystal |
| Storage Condition | 0-6°C |
| HTC | 2925290013 |
| SMILES | CN=CNc1ccc(C)cc1C |
| InChI | InChI=1S/C10H14N2.ClH/c1-8-4-5-10(9(2)6-8)12-7-11-3;/h4-7H,1-3H3,(H,11,12);1H |
| InChI Key | JIIOLEGNERQDIP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dimercapto-5,6-diaminopyrimidine | 31295-41-7 | 2A-9040868 |
| Tris(2,4-ditert-butylphenyl) phosphite | 31570-04-4 | 2A-9040915 |
| 5-Bromo-2,4-dimethoxybenzoic acid | 32246-20-1 | 2A-9041021 |
| 2,4-Dihydroxy-6-nitroquinazoline | 32618-85-2 | 2A-9041082 |
| Cholest-5-en-3beta-yl 2,4-dichlorobenzoate | 32832-01-2 | 2A-9041125 |
| Methyl N-2,4-dimethylphenylformimidate | 33108-52-0 | 2A-9041185 |
| Acetochlor | 34256-82-1 | 2A-9041423 |
| (2,4-Dimethyl-1,3-thiazol-5-yl)acetic acid | 34272-65-6 | 2A-9041428 |
| Glyphosate-sodium | 34494-03-6 | 2A-9041476 |
| 2,4-Difluoropyridine | 34941-90-7 | 2A-9041581 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA