
CAS Number26155-31-7
SynonymsRUMATEL; trate; morantreltartrate; EINECS 247-481-5; 1,4,5,6-Tetrahydro-1-methyl-2-(2-[3-methyl-2-thienyl]ethenyl)pyrimidine; MORTANELTARTRATE; MFCD00079449; MORANTEL TARTRATE HYDRATE; Morantel (+)-tartrate salt; Morantel hydrogen tartrate; Morantel tartrate; Morantel (tartrate)
Molecular FormulaC16H22N2O6S
Molecular Weight370.421
Purity98.00%
Boiling Point334.6ºC at 760 mmHg
AppearanceWhite or light yellow, crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26155-31-7 |
| Catalog No. | 2A-9039880 |
| Chinese Name | 酒石酸甲噻嘧啶 |
| Synonyms | RUMATEL; trate; morantreltartrate; EINECS 247-481-5; 1,4,5,6-Tetrahydro-1-methyl-2-(2-[3-methyl-2-thienyl]ethenyl)pyrimidine; MORTANELTARTRATE; MFCD00079449; MORANTEL TARTRATE HYDRATE; Morantel (+)-tartrate salt; Morantel hydrogen tartrate; Morantel tartrate; Morantel (tartrate) |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.421 |
| Purity | 98.00 |
| Boiling Point | 334.6ºC at 760 mmHg |
| Appearance | White or light yellow, crystalline powder |
| Storage Condition | -20℃ |
| Application | Morantel tartaric acid is a broad-spectrum anthelmintic with high efficacy and low toxicity. |
| SMILES | Cc1ccsc1C=CC1=NCCCN1C.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H16N2S.C4H6O6/c1-10-6-9-15-11(10)4-5-12-13-7-3-8-14(12)2;5-1(3(7)8)2(6)4(9)10/h4-6,9H,3,7-8H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/b5-4+;/t;1-,2-/m.1/s1 |
| InChI Key | GGXQONWGCAQGNA-UUSVNAAPSA-N |
| Transport Info | Product Name: MorantelTartrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Acetamidobenzylidene)malononitrile | 26088-79-9 | 2A-9039865 |
| 4-Propylphenylacetic acid | 26114-12-5 | 2A-9039872 |
| Nalpha-Acetyl-D-asparagine | 26117-27-1 | 2A-9039874 |
| Clofop | 26129-32-8 | 2A-9039875 |
| 3,4-Dimethylbenzamidine | 26130-47-2 | 2A-9039876 |
| Polyquaternium-37 | 26161-33-1 | 2A-9039883 |
| 1-Benzo[b]thiophen-3-yl-2-bromoethan-1-one | 26167-45-3 | 2A-9039886 |
| 3-Acetylthianaphthene | 26168-40-1 | 2A-9039887 |
| Tolmetin | 26171-23-3 | 2A-9039888 |
| Isothiazolinones; 5-Chloro-2-methyl-4-isothiazolin-3-one | 26172-55-4 | 2A-9039890 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA