
CAS Number26129-32-8
Synonyms2-[4-(4-chlorophenoxy)phenoxy]propanoic acid; rac-(2R)-2-[4-(4-chlorophenoxy)phenoxy]propanoic acid; Clofop [ISO]; LF 479; HCG 004; 2-[4'-(4''-chlorophenoxy)phenoxy]-propionic acid; D-2-[p-(p-chlorophenoxy)phenoxy]propionic acid; 2-(4-(4-Chlorophenoxy)phenoxy)propanoic acid; EINECS 255-626-9; MFCD00792461; (RS)-2-[4-(4-chlorophenoxy)phenoxy]propionic acid; fenofibric acid; D-2-[4-(4-chlorophenoxy)-phenoxy]-propionic acid
Molecular FormulaC15H13ClO4
Molecular Weight292.71400
Purity98.00%
Density1.306 g/cm3
Boiling Point431.9ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26129-32-8 |
| Catalog No. | 2A-9039875 |
| Chinese Name | 2-(4-(4-氯苯氧基)苯氧基)丙酸 |
| Synonyms | 2-[4-(4-chlorophenoxy)phenoxy]propanoic acid; rac-(2R)-2-[4-(4-chlorophenoxy)phenoxy]propanoic acid; Clofop [ISO]; LF 479; HCG 004; 2-[4'-(4''-chlorophenoxy)phenoxy]-propionic acid; D-2-[p-(p-chlorophenoxy)phenoxy]propionic acid; 2-(4-(4-Chlorophenoxy)phenoxy)propanoic acid; EINECS 255-626-9; MFCD00792461; (RS)-2-[4-(4-chlorophenoxy)phenoxy]propionic acid; fenofibric acid; D-2-[4-(4-chlorophenoxy)-phenoxy]-propionic acid |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.71400 |
| Purity | 98.00 |
| Density | 1.306 g/cm3 |
| Boiling Point | 431.9ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | CC(Oc1ccc(Oc2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C15H13ClO4/c1-10(15(17)18)19-12-6-8-14(9-7-12)20-13-4-2-11(16)3-5-13/h2-10H,1H3,(H,17,18) |
| InChI Key | BSFAVVHPEZCASB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromobutyryl bromide | 26074-52-2 | 2A-9039861 |
| 3-Aminohexahydro-2H-azepin-2-one hydrochloride | 26081-07-2 | 2A-9039863 |
| 2-(4-Acetamidobenzylidene)malononitrile | 26088-79-9 | 2A-9039865 |
| 4-Propylphenylacetic acid | 26114-12-5 | 2A-9039872 |
| Nalpha-Acetyl-D-asparagine | 26117-27-1 | 2A-9039874 |
| 3,4-Dimethylbenzamidine | 26130-47-2 | 2A-9039876 |
| Morantel tartrate | 26155-31-7 | 2A-9039880 |
| Polyquaternium-37 | 26161-33-1 | 2A-9039883 |
| 1-Benzo[b]thiophen-3-yl-2-bromoethan-1-one | 26167-45-3 | 2A-9039886 |
| 3-Acetylthianaphthene | 26168-40-1 | 2A-9039887 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA